2-Isopropyl 5-methyl 3-methoxy-4-oxo-4h-pyran-2,5-dicarboxylate
Modify Date: 2026-08-08 17:27:29
2-Isopropyl 5-methyl 3-methoxy-4-oxo-4h-pyran-2,5-dicarboxylate structure
|
Common Name | 2-Isopropyl 5-methyl 3-methoxy-4-oxo-4h-pyran-2,5-dicarboxylate | ||
|---|---|---|---|---|
| CAS Number | 2015220-44-5 | Molecular Weight | 270.23 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H14O7 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2-Isopropyl 5-methyl 3-methoxy-4-oxo-4h-pyran-2,5-dicarboxylate |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C12H14O7 |
|---|---|
| Molecular Weight | 270.23 |
| InChIKey | ZPZYNMFCMYXMIS-UHFFFAOYSA-N |
| SMILES | COC(=O)c1coc(C(=O)OC(C)C)c(OC)c1=O |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the English name of 2-Isopropyl 5-methyl 3-methoxy-4-oxo-4h-pyran-2,5-dicarboxylate? |
| A: The English name of 2-Isopropyl 5-methyl 3-methoxy-4-oxo-4h-pyran-2,5-dicarboxylate is 2-Isopropyl 5-methyl 3-methoxy-4-oxo-4h-pyran-2,5-dicarboxylate. |
| Q: What is the InChIKey of 2-Isopropyl 5-methyl 3-methoxy-4-oxo-4h-pyran-2,5-dicarboxylate? |
| A: InChIKey of 2-Isopropyl 5-methyl 3-methoxy-4-oxo-4h-pyran-2,5-dicarboxylate is ZPZYNMFCMYXMIS-UHFFFAOYSA-N. |
| Q: What is the SMILES notation of 2-Isopropyl 5-methyl 3-methoxy-4-oxo-4h-pyran-2,5-dicarboxylate? |
| A: SMILES notation of 2-Isopropyl 5-methyl 3-methoxy-4-oxo-4h-pyran-2,5-dicarboxylate is COC(=O)c1coc(C(=O)OC(C)C)c(OC)c1=O. |
| Q: What is the molecular formula of 2-Isopropyl 5-methyl 3-methoxy-4-oxo-4h-pyran-2,5-dicarboxylate? |
| A: Molecular formula of 2-Isopropyl 5-methyl 3-methoxy-4-oxo-4h-pyran-2,5-dicarboxylate is C12H14O7. |
| Q: What is the CAS number of 2-Isopropyl 5-methyl 3-methoxy-4-oxo-4h-pyran-2,5-dicarboxylate? |
| A: CAS number of 2-Isopropyl 5-methyl 3-methoxy-4-oxo-4h-pyran-2,5-dicarboxylate is 2015220-44-5. |
| Q: What is the molecular weight of 2-Isopropyl 5-methyl 3-methoxy-4-oxo-4h-pyran-2,5-dicarboxylate? |
| A: Molecular weight of 2-Isopropyl 5-methyl 3-methoxy-4-oxo-4h-pyran-2,5-dicarboxylate is 270.23. |
| Q: What is the Chinese name of 2015220-44-5? |
| A: Chinese name of 2015220-44-5 is 2015220-44-5. |