2-(4-Amino-2-Methyl-phenyl)-1,1,1,3,3,3-hexafluoro-propan-2-ol structure
|
Common Name | 2-(4-Amino-2-Methyl-phenyl)-1,1,1,3,3,3-hexafluoro-propan-2-ol | ||
|---|---|---|---|---|
| CAS Number | 2017-31-4 | Molecular Weight | 273.17500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H9F6NO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-(4-amino-2-methylphenyl)-1,1,1,3,3,3-hexafluoropropan-2-ol |
|---|
| Molecular Formula | C10H9F6NO |
|---|---|
| Molecular Weight | 273.17500 |
| Exact Mass | 273.05900 |
| PSA | 46.25000 |
| LogP | 3.47060 |
| InChIKey | OVLHTNUPVPBFPJ-UHFFFAOYSA-N |
| SMILES | Cc1cc(N)ccc1C(O)(C(F)(F)F)C(F)(F)F |
| HS Code | 2922199090 |
|---|
| HS Code | 2922199090 |
|---|---|
| Summary | 2922199090. other amino-alcohols, other than those containing more than one kind of oxygen function, their ethers and esters; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |