1-amino-N-butyl-9,10-dihydro-4-(methylamino)-9,10-dioxoanthracene-2-carboxamide structure
|
Common Name | 1-amino-N-butyl-9,10-dihydro-4-(methylamino)-9,10-dioxoanthracene-2-carboxamide | ||
|---|---|---|---|---|
| CAS Number | 20171-06-6 | Molecular Weight | 351.39900 | |
| Density | 1.298g/cm3 | Boiling Point | 572.3ºC at 760mmHg | |
| Molecular Formula | C20H21N3O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 299.9ºC | |
| Name | 1-amino-N-butyl-4-(methylamino)-9,10-dioxoanthracene-2-carboxamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.298g/cm3 |
|---|---|
| Boiling Point | 572.3ºC at 760mmHg |
| Molecular Formula | C20H21N3O3 |
| Molecular Weight | 351.39900 |
| Flash Point | 299.9ºC |
| Exact Mass | 351.15800 |
| PSA | 104.78000 |
| LogP | 3.84480 |
| Vapour Pressure | 4.18E-13mmHg at 25°C |
| Index of Refraction | 1.66 |
| InChIKey | UNEWTZKBSHBFEM-UHFFFAOYSA-N |
| SMILES | CCCCNC(=O)c1cc(NC)c2c(c1N)C(=O)c1ccccc1C2=O |
| HS Code | 2924299090 |
|---|
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| einecs 243-559-8 |