5-cholesten-3-ol 6-[(7-nitro-2-1,3-benzoxadiazol-4-yl)amino]caproate structure
|
Common Name | 5-cholesten-3-ol 6-[(7-nitro-2-1,3-benzoxadiazol-4-yl)amino]caproate | ||
|---|---|---|---|---|
| CAS Number | 201731-19-3 | Molecular Weight | 662.902 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 736.3±70.0 °C at 760 mmHg | |
| Molecular Formula | C39H58N4O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 399.1±35.7 °C | |
Use of 5-cholesten-3-ol 6-[(7-nitro-2-1,3-benzoxadiazol-4-yl)amino]caproate3-hexanoyl-NBD cholesterol is a fluorescently tagged cholesterol derivative with the hydrophilic NBD fluorophore attached to carbon 3, at the hydrophilic end of cholesterol, separated by a 6-carbon spacer. |
| Name | (3β,20R)-Cholest-5-en-3-yl 6-[(7-nitro-2,1,3-benzoxadiazol-4-yl)a mino]hexanoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 736.3±70.0 °C at 760 mmHg |
| Molecular Formula | C39H58N4O5 |
| Molecular Weight | 662.902 |
| Flash Point | 399.1±35.7 °C |
| Exact Mass | 662.440735 |
| PSA | 123.07000 |
| LogP | 13.06 |
| Vapour Pressure | 0.0±2.4 mmHg at 25°C |
| Index of Refraction | 1.573 |
| InChIKey | YZAQIPGLFHPDPI-FIWRCADXSA-N |
| SMILES | CC(C)CCCC(C)C1CCC2C3CC=C4CC(OC(=O)CCCCCNc5ccc([N+](=O)[O-])c6nonc56)CCC4(C)C3CCC12C |
| Hexanoic acid, 6-[(7-nitro-2,1,3-benzoxadiazol-4-yl)amino]-, (3β,20R)-cholest-5-en-3-yl ester |
| (3β,20R)-Cholest-5-en-3-yl 6-[(7-nitro-2,1,3-benzoxadiazol-4-yl)amino]hexanoate |