2,4-Dichloro-3,5,6-trifluoroanisole
Modify Date: 2026-07-08 16:18:26
2,4-Dichloro-3,5,6-trifluoroanisole structure
|
Common Name | 2,4-Dichloro-3,5,6-trifluoroanisole | ||
|---|---|---|---|---|
| CAS Number | 20174-07-6 | Molecular Weight | 231.00 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C7H3Cl2F3O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2,4-Dichloro-3,5,6-trifluoroanisole |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C7H3Cl2F3O |
|---|---|
| Molecular Weight | 231.00 |
| InChIKey | JMSGTZRSVOIGJC-UHFFFAOYSA-N |
| SMILES | COc1c(F)c(F)c(Cl)c(F)c1Cl |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the Chinese name of 20174-07-6? |
| A: Chinese name of 20174-07-6 is 20174-07-6. |
| Q: What is the molecular weight of 2,4-Dichloro-3,5,6-trifluoroanisole? |
| A: Molecular weight of 2,4-Dichloro-3,5,6-trifluoroanisole is 231.00. |
| Q: What is the SMILES notation of 2,4-Dichloro-3,5,6-trifluoroanisole? |
| A: SMILES notation of 2,4-Dichloro-3,5,6-trifluoroanisole is COc1c(F)c(F)c(Cl)c(F)c1Cl. |
| Q: What is the CAS number of 2,4-Dichloro-3,5,6-trifluoroanisole? |
| A: CAS number of 2,4-Dichloro-3,5,6-trifluoroanisole is 20174-07-6. |
| Q: What is the InChIKey of 2,4-Dichloro-3,5,6-trifluoroanisole? |
| A: InChIKey of 2,4-Dichloro-3,5,6-trifluoroanisole is JMSGTZRSVOIGJC-UHFFFAOYSA-N. |
| Q: What is the English name of 2,4-Dichloro-3,5,6-trifluoroanisole? |
| A: The English name of 2,4-Dichloro-3,5,6-trifluoroanisole is 2,4-Dichloro-3,5,6-trifluoroanisole. |
| Q: What is the molecular formula of 2,4-Dichloro-3,5,6-trifluoroanisole? |
| A: Molecular formula of 2,4-Dichloro-3,5,6-trifluoroanisole is C7H3Cl2F3O. |