N-{[(2-Methyl-2-Propanyl)Oxy]Carbonyl}-L-(1-13C)Alanine structure
|
Common Name | N-{[(2-Methyl-2-Propanyl)Oxy]Carbonyl}-L-(1-13C)Alanine | ||
|---|---|---|---|---|
| CAS Number | 201740-78-5 | Molecular Weight | 190.202 | |
| Density | 1.1±0.1 g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C8H15NO4 | Melting Point | 79-83ºC(lit.) | |
| MSDS | USA | Flash Point | N/A | |
| Name | N-(tert-Butoxycarbonyl)-L-alanine-1-13C |
|---|---|
| Synonym | More Synonyms |
| Density | 1.1±0.1 g/cm3 |
|---|---|
| Melting Point | 79-83ºC(lit.) |
| Molecular Formula | C8H15NO4 |
| Molecular Weight | 190.202 |
| Exact Mass | 190.103470 |
| PSA | 79.12000 |
| LogP | 1.18860 |
| Index of Refraction | 1.460 |
| InChIKey | QVHJQCGUWFKTSE-SANWUMGISA-N |
| SMILES | CC(NC(=O)OC(C)(C)C)C(=O)O |
| RIDADR | NONH for all modes of transport |
|---|---|
| WGK Germany | 3 |
|
~%
N-{[(2-Methyl-2... CAS#:201740-78-5 |
| Literature: Tokyo Gas Company Limited Patent: US7404945 B2, 2008 ; Location in patent: Page/Page column 21-22 ; |
| L-Alanine-1-13C,N-t-Boc derivative |
| L-Alanine-1-C, N-[(1,1-dimethylethoxy)carbonyl]- |
| Boc-Ala-OH-1-13C |
| MFCD00083884 |
| N-{[(2-Methyl-2-propanyl)oxy]carbonyl}-L-(1-C)alanine |