Benzamide,n-[4-(2-hydroxyethoxy)-2-methylphenyl]-4-(1-piperazinyl)-,hydrochloride
Modify Date: 2025-11-05 21:05:00
![Benzamide,n-[4-(2-hydroxyethoxy)-2-methylphenyl]-4-(1-piperazinyl)-,hydrochloride Structure](https://www.chemsrc.com/extcaspic/071/201741-06-2.png)
Benzamide,n-[4-(2-hydroxyethoxy)-2-methylphenyl]-4-(1-piperazinyl)-,hydrochloride structure
|
Common Name | Benzamide,n-[4-(2-hydroxyethoxy)-2-methylphenyl]-4-(1-piperazinyl)-,hydrochloride | ||
|---|---|---|---|---|
| CAS Number | 201741-06-2 | Molecular Weight | 391.9 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C20H26ClN3O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Benzamide,n-[4-(2-hydroxyethoxy)-2-methylphenyl]-4-(1-piperazinyl)-,hydrochloride |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C20H26ClN3O3 |
|---|---|
| Molecular Weight | 391.9 |
| InChIKey | DSHYYZZIKGUEHK-UHFFFAOYSA-N |
| SMILES | Cc1cc(OCCO)ccc1NC(=O)c1ccc(N2CCNCC2)cc1.Cl |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular weight of Benzamide,n-[4-(2-hydroxyethoxy)-2-methylphenyl]-4-(1-piperazinyl)-,hydrochloride? |
| A: Molecular weight of Benzamide,n-[4-(2-hydroxyethoxy)-2-methylphenyl]-4-(1-piperazinyl)-,hydrochloride is 391.9. |
| Q: What is the Chinese name of 201741-06-2? |
| A: Chinese name of 201741-06-2 is 201741-06-2. |
| Q: What is the SMILES notation of Benzamide,n-[4-(2-hydroxyethoxy)-2-methylphenyl]-4-(1-piperazinyl)-,hydrochloride? |
| A: SMILES notation of Benzamide,n-[4-(2-hydroxyethoxy)-2-methylphenyl]-4-(1-piperazinyl)-,hydrochloride is Cc1cc(OCCO)ccc1NC(=O)c1ccc(N2CCNCC2)cc1.Cl. |
| Q: What is the molecular formula of Benzamide,n-[4-(2-hydroxyethoxy)-2-methylphenyl]-4-(1-piperazinyl)-,hydrochloride? |
| A: Molecular formula of Benzamide,n-[4-(2-hydroxyethoxy)-2-methylphenyl]-4-(1-piperazinyl)-,hydrochloride is C20H26ClN3O3. |
| Q: What is the CAS number of Benzamide,n-[4-(2-hydroxyethoxy)-2-methylphenyl]-4-(1-piperazinyl)-,hydrochloride? |
| A: CAS number of Benzamide,n-[4-(2-hydroxyethoxy)-2-methylphenyl]-4-(1-piperazinyl)-,hydrochloride is 201741-06-2. |
| Q: What is the InChIKey of Benzamide,n-[4-(2-hydroxyethoxy)-2-methylphenyl]-4-(1-piperazinyl)-,hydrochloride? |
| A: InChIKey of Benzamide,n-[4-(2-hydroxyethoxy)-2-methylphenyl]-4-(1-piperazinyl)-,hydrochloride is DSHYYZZIKGUEHK-UHFFFAOYSA-N. |
| Q: What is the English name of Benzamide,n-[4-(2-hydroxyethoxy)-2-methylphenyl]-4-(1-piperazinyl)-,hydrochloride? |
| A: The English name of Benzamide,n-[4-(2-hydroxyethoxy)-2-methylphenyl]-4-(1-piperazinyl)-,hydrochloride is Benzamide,n-[4-(2-hydroxyethoxy)-2-methylphenyl]-4-(1-piperazinyl)-,hydrochloride. |