2,2'-Dimethyl-5,5'-dihydroxy-6,6'-bi[1,4-naphthoquinone] structure
|
Common Name | 2,2'-Dimethyl-5,5'-dihydroxy-6,6'-bi[1,4-naphthoquinone] | ||
|---|---|---|---|---|
| CAS Number | 20175-85-3 | Molecular Weight | 374.34300 | |
| Density | 1.475g/cm3 | Boiling Point | 672.7ºC at 760 mmHg | |
| Molecular Formula | C22H14O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 374.6ºC | |
| Name | 5-hydroxy-6-(1-hydroxy-6-methyl-5,8-dioxonaphthalen-2-yl)-2-methylnaphthalene-1,4-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.475g/cm3 |
|---|---|
| Boiling Point | 672.7ºC at 760 mmHg |
| Molecular Formula | C22H14O6 |
| Molecular Weight | 374.34300 |
| Flash Point | 374.6ºC |
| Exact Mass | 374.07900 |
| PSA | 108.74000 |
| LogP | 3.41540 |
| Vapour Pressure | 1.04E-18mmHg at 25°C |
| Index of Refraction | 1.692 |
| InChIKey | TXVAHWOABLOYCD-UHFFFAOYSA-N |
| SMILES | CC1=CC(=O)c2c(ccc(-c3ccc4c(c3O)C(=O)C=C(C)C4=O)c2O)C1=O |
| HS Code | 2914400090 |
|---|
| HS Code | 2914400090 |
|---|---|
| Summary | 2914400090 other ketone-alcohols and ketone-aldehydes。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:5.5%。General tariff:30.0% |
| Elliptinone |
| 1,1'-Dihydroxy-6,6'-dimethyl-2,2'-binaphthalene-5,5',8,8'-tetrone |