3'-Hydroxy[1,2'-binaphthalene]-1',3,4,4'-tetrone
Modify Date: 2025-09-23 20:57:13
![3'-Hydroxy[1,2'-binaphthalene]-1',3,4,4'-tetrone Structure](https://www.chemsrc.com/extcaspic/300/20175-91-1.png)
3'-Hydroxy[1,2'-binaphthalene]-1',3,4,4'-tetrone structure
|
Common Name | 3'-Hydroxy[1,2'-binaphthalene]-1',3,4,4'-tetrone | ||
|---|---|---|---|---|
| CAS Number | 20175-91-1 | Molecular Weight | 330.3 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C20H10O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 3'-Hydroxy[1,2'-binaphthalene]-1',3,4,4'-tetrone |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C20H10O5 |
|---|---|
| Molecular Weight | 330.3 |
| InChIKey | QVWWAUPYZCEKMH-UHFFFAOYSA-N |
| SMILES | O=C1C=C(C2=C(O)c3ccccc3C(=O)C2=O)c2ccccc2C1=O |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular formula of 3'-Hydroxy[1,2'-binaphthalene]-1',3,4,4'-tetrone? |
| A: Molecular formula of 3'-Hydroxy[1,2'-binaphthalene]-1',3,4,4'-tetrone is C20H10O5. |
| Q: What is the SMILES notation of 3'-Hydroxy[1,2'-binaphthalene]-1',3,4,4'-tetrone? |
| A: SMILES notation of 3'-Hydroxy[1,2'-binaphthalene]-1',3,4,4'-tetrone is O=C1C=C(C2=C(O)c3ccccc3C(=O)C2=O)c2ccccc2C1=O. |
| Q: What is the CAS number of 3'-Hydroxy[1,2'-binaphthalene]-1',3,4,4'-tetrone? |
| A: CAS number of 3'-Hydroxy[1,2'-binaphthalene]-1',3,4,4'-tetrone is 20175-91-1. |
| Q: What is the Chinese name of 20175-91-1? |
| A: Chinese name of 20175-91-1 is 20175-91-1. |
| Q: What is the InChIKey of 3'-Hydroxy[1,2'-binaphthalene]-1',3,4,4'-tetrone? |
| A: InChIKey of 3'-Hydroxy[1,2'-binaphthalene]-1',3,4,4'-tetrone is QVWWAUPYZCEKMH-UHFFFAOYSA-N. |
| Q: What is the molecular weight of 3'-Hydroxy[1,2'-binaphthalene]-1',3,4,4'-tetrone? |
| A: Molecular weight of 3'-Hydroxy[1,2'-binaphthalene]-1',3,4,4'-tetrone is 330.3. |
| Q: What is the English name of 3'-Hydroxy[1,2'-binaphthalene]-1',3,4,4'-tetrone? |
| A: The English name of 3'-Hydroxy[1,2'-binaphthalene]-1',3,4,4'-tetrone is 3'-Hydroxy[1,2'-binaphthalene]-1',3,4,4'-tetrone. |