p-[[1-amino-4-hydroxy-9,10-dioxo-9,10-dihydro-2-anthryl]oxy]phenyl acetate structure
|
Common Name | p-[[1-amino-4-hydroxy-9,10-dioxo-9,10-dihydro-2-anthryl]oxy]phenyl acetate | ||
|---|---|---|---|---|
| CAS Number | 20179-08-2 | Molecular Weight | 389.35800 | |
| Density | 1.452g/cm3 | Boiling Point | 618.7ºC at 760mmHg | |
| Molecular Formula | C22H15NO6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 328ºC | |
| Name | [4-(1-amino-4-hydroxy-9,10-dioxoanthracen-2-yl)oxyphenyl] acetate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.452g/cm3 |
|---|---|
| Boiling Point | 618.7ºC at 760mmHg |
| Molecular Formula | C22H15NO6 |
| Molecular Weight | 389.35800 |
| Flash Point | 328ºC |
| Exact Mass | 389.09000 |
| PSA | 115.92000 |
| LogP | 4.04860 |
| Vapour Pressure | 6.69E-16mmHg at 25°C |
| Index of Refraction | 1.691 |
| InChIKey | FQNOCNXTYADZSJ-UHFFFAOYSA-N |
| SMILES | CC(=O)Oc1ccc(Oc2cc(O)c3c(c2N)C(=O)c2ccccc2C3=O)cc1 |
| HS Code | 2922509090 |
|---|
| HS Code | 2922509090 |
|---|---|
| Summary | 2922509090. other amino-alcohol-phenols, amino-acid-phenols and other amino-compounds with oxygen function. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| einecs 243-565-0 |