Aziridine,1,1'-(phenylphosphinothioylidene)bis[2-methyl- (9CI) structure
|
Common Name | Aziridine,1,1'-(phenylphosphinothioylidene)bis[2-methyl- (9CI) | ||
|---|---|---|---|---|
| CAS Number | 20180-18-1 | Molecular Weight | 252.31600 | |
| Density | 1.26g/cm3 | Boiling Point | 341.8ºC at 760mmHg | |
| Molecular Formula | C12H17N2PS | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 160.5ºC | |
| Name | bis(2-methylaziridin-1-yl)-phenyl-sulfanylidene-λ5-phosphane |
|---|---|
| Synonym | More Synonyms |
| Density | 1.26g/cm3 |
|---|---|
| Boiling Point | 341.8ºC at 760mmHg |
| Molecular Formula | C12H17N2PS |
| Molecular Weight | 252.31600 |
| Flash Point | 160.5ºC |
| Exact Mass | 252.08500 |
| PSA | 47.92000 |
| LogP | 2.55600 |
| Vapour Pressure | 7.86E-05mmHg at 25°C |
| Index of Refraction | 1.64 |
| InChIKey | XQDURKANNREFSK-UHFFFAOYSA-N |
| SMILES | CC1CN1P(=S)(c1ccccc1)N1CC1C |
| HS Code | 2933990090 |
|---|
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| HMS3089F21 |
| bis(methylaziridinyl)-phenyl-phosphine sulfide |
| 1,1'-(phenylphosphorothioyl)bis(2-methylaziridine) |