4-(5-ETHOXYCARBONYL-PYRIDIN-2-YL)-PIPERAZINE-1-CARBOXYLIC ACID TERT-BUTYL ESTER
4-(5-ETHOXYCARBONYL-PYRIDIN-2-YL)-PIPERAZINE-1-CARBOXYLIC ACID TERT-BUTYL ESTER structure
|
Common Name | 4-(5-ETHOXYCARBONYL-PYRIDIN-2-YL)-PIPERAZINE-1-CARBOXYLIC ACID TERT-BUTYL ESTER | ||
|---|---|---|---|---|
| CAS Number | 201809-20-3 | Molecular Weight | 335.39800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C17H25N3O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | tert-butyl 4-(5-ethoxycarbonylpyridin-2-yl)piperazine-1-carboxylate |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C17H25N3O4 |
|---|---|
| Molecular Weight | 335.39800 |
| Exact Mass | 335.18500 |
| PSA | 71.97000 |
| LogP | 2.31830 |
| InChIKey | AYCWMHWDFCCHLE-UHFFFAOYSA-N |
| SMILES | CCOC(=O)c1ccc(N2CCN(C(=O)OC(C)(C)C)CC2)nc1 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~%
4-(5-ETHOXYCARB... CAS#:201809-20-3 |
| Literature: EXELIXIS, INC. Patent: WO2009/55077 A1, 2009 ; Location in patent: Page/Page column 374 ; |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 2 | |
|---|---|
| DownStream 1 | |
CAS#:201809-22-5This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the CAS number of tert-butyl 4-(5-ethoxycarbonylpyridin-2-yl)piperazine-1-carboxylate? |
| A: CAS number of tert-butyl 4-(5-ethoxycarbonylpyridin-2-yl)piperazine-1-carboxylate is 201809-20-3. |
| Q: What is the molecular weight of tert-butyl 4-(5-ethoxycarbonylpyridin-2-yl)piperazine-1-carboxylate? |
| A: Molecular weight of tert-butyl 4-(5-ethoxycarbonylpyridin-2-yl)piperazine-1-carboxylate is 335.39800. |
| Q: What is the English name of tert-butyl 4-(5-ethoxycarbonylpyridin-2-yl)piperazine-1-carboxylate? |
| A: The English name of tert-butyl 4-(5-ethoxycarbonylpyridin-2-yl)piperazine-1-carboxylate is tert-butyl 4-(5-ethoxycarbonylpyridin-2-yl)piperazine-1-carboxylate. |
| Q: What are the upstream materials of tert-butyl 4-(5-ethoxycarbonylpyridin-2-yl)piperazine-1-carboxylate? |
| A: Related upstream materials(CAS) of tert-butyl 4-(5-ethoxycarbonylpyridin-2-yl)piperazine-1-carboxylate: 49608-01-7;57260-71-6. |
| Q: What is the InChIKey of tert-butyl 4-(5-ethoxycarbonylpyridin-2-yl)piperazine-1-carboxylate? |
| A: InChIKey of tert-butyl 4-(5-ethoxycarbonylpyridin-2-yl)piperazine-1-carboxylate is AYCWMHWDFCCHLE-UHFFFAOYSA-N. |
| Q: What is the LogP of tert-butyl 4-(5-ethoxycarbonylpyridin-2-yl)piperazine-1-carboxylate? |
| A: LogP of tert-butyl 4-(5-ethoxycarbonylpyridin-2-yl)piperazine-1-carboxylate is 2.31830. |
| Q: What is the molecular formula of tert-butyl 4-(5-ethoxycarbonylpyridin-2-yl)piperazine-1-carboxylate? |
| A: Molecular formula of tert-butyl 4-(5-ethoxycarbonylpyridin-2-yl)piperazine-1-carboxylate is C17H25N3O4. |
| Q: What is the polar surface area (PSA) of tert-butyl 4-(5-ethoxycarbonylpyridin-2-yl)piperazine-1-carboxylate? |
| A: Polar surface area (PSA) of tert-butyl 4-(5-ethoxycarbonylpyridin-2-yl)piperazine-1-carboxylate is 71.97000. |
| Q: What is the SMILES notation of tert-butyl 4-(5-ethoxycarbonylpyridin-2-yl)piperazine-1-carboxylate? |
| A: SMILES notation of tert-butyl 4-(5-ethoxycarbonylpyridin-2-yl)piperazine-1-carboxylate is CCOC(=O)c1ccc(N2CCN(C(=O)OC(C)(C)C)CC2)nc1. |
| Q: What are the downstream products of tert-butyl 4-(5-ethoxycarbonylpyridin-2-yl)piperazine-1-carboxylate? |
| A: Related downstream products(CAS) of tert-butyl 4-(5-ethoxycarbonylpyridin-2-yl)piperazine-1-carboxylate: 201809-22-5. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |
| Dayang Chem (Hangzhou) Co., Ltd. |