tert-butyl 8-bromo-3,4-dihydropyrazino[1,2-a]indole-2(1H)-carboxylate structure
|
Common Name | tert-butyl 8-bromo-3,4-dihydropyrazino[1,2-a]indole-2(1H)-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 201809-34-9 | Molecular Weight | 351.24 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H19BrN2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | tert-butyl 8-bromo-3,4-dihydropyrazino[1,2-a]indole-2(1H)-carboxylate |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C16H19BrN2O2 |
|---|---|
| Molecular Weight | 351.24 |
| InChIKey | XHBZGCJELJTZFQ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCn2c(cc3cc(Br)ccc32)C1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the English name of tert-butyl 8-bromo-3,4-dihydropyrazino[1,2-a]indole-2(1H)-carboxylate? |
| A: The English name of tert-butyl 8-bromo-3,4-dihydropyrazino[1,2-a]indole-2(1H)-carboxylate is tert-butyl 8-bromo-3,4-dihydropyrazino[1,2-a]indole-2(1H)-carboxylate. |
| Q: What is the SMILES notation of tert-butyl 8-bromo-3,4-dihydropyrazino[1,2-a]indole-2(1H)-carboxylate? |
| A: SMILES notation of tert-butyl 8-bromo-3,4-dihydropyrazino[1,2-a]indole-2(1H)-carboxylate is CC(C)(C)OC(=O)N1CCn2c(cc3cc(Br)ccc32)C1. |
| Q: What is the CAS number of tert-butyl 8-bromo-3,4-dihydropyrazino[1,2-a]indole-2(1H)-carboxylate? |
| A: CAS number of tert-butyl 8-bromo-3,4-dihydropyrazino[1,2-a]indole-2(1H)-carboxylate is 201809-34-9. |
| Q: What is the Chinese name of 201809-34-9? |
| A: Chinese name of 201809-34-9 is 201809-34-9. |
| Q: What is the molecular formula of tert-butyl 8-bromo-3,4-dihydropyrazino[1,2-a]indole-2(1H)-carboxylate? |
| A: Molecular formula of tert-butyl 8-bromo-3,4-dihydropyrazino[1,2-a]indole-2(1H)-carboxylate is C16H19BrN2O2. |
| Q: What is the InChIKey of tert-butyl 8-bromo-3,4-dihydropyrazino[1,2-a]indole-2(1H)-carboxylate? |
| A: InChIKey of tert-butyl 8-bromo-3,4-dihydropyrazino[1,2-a]indole-2(1H)-carboxylate is XHBZGCJELJTZFQ-UHFFFAOYSA-N. |
| Q: What is the molecular weight of tert-butyl 8-bromo-3,4-dihydropyrazino[1,2-a]indole-2(1H)-carboxylate? |
| A: Molecular weight of tert-butyl 8-bromo-3,4-dihydropyrazino[1,2-a]indole-2(1H)-carboxylate is 351.24. |