7-Bromo-3,4-dihydro-[1]benzofuro[2,3-c]pyridine structure
|
Common Name | 7-Bromo-3,4-dihydro-[1]benzofuro[2,3-c]pyridine | ||
|---|---|---|---|---|
| CAS Number | 201809-80-5 | Molecular Weight | 250.09 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H8BrNO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 7-Bromo-3,4-dihydro-[1]benzofuro[2,3-c]pyridine |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C11H8BrNO |
|---|---|
| Molecular Weight | 250.09 |
| InChIKey | SSMWZHMQYTTWGT-UHFFFAOYSA-N |
| SMILES | Brc1ccc2c3c(oc2c1)C=NCC3 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular formula of 7-Bromo-3,4-dihydro-[1]benzofuro[2,3-c]pyridine? |
| A: Molecular formula of 7-Bromo-3,4-dihydro-[1]benzofuro[2,3-c]pyridine is C11H8BrNO. |
| Q: What is the InChIKey of 7-Bromo-3,4-dihydro-[1]benzofuro[2,3-c]pyridine? |
| A: InChIKey of 7-Bromo-3,4-dihydro-[1]benzofuro[2,3-c]pyridine is SSMWZHMQYTTWGT-UHFFFAOYSA-N. |
| Q: What is the Chinese name of 201809-80-5? |
| A: Chinese name of 201809-80-5 is 201809-80-5. |
| Q: What is the SMILES notation of 7-Bromo-3,4-dihydro-[1]benzofuro[2,3-c]pyridine? |
| A: SMILES notation of 7-Bromo-3,4-dihydro-[1]benzofuro[2,3-c]pyridine is Brc1ccc2c3c(oc2c1)C=NCC3. |
| Q: What is the molecular weight of 7-Bromo-3,4-dihydro-[1]benzofuro[2,3-c]pyridine? |
| A: Molecular weight of 7-Bromo-3,4-dihydro-[1]benzofuro[2,3-c]pyridine is 250.09. |
| Q: What is the CAS number of 7-Bromo-3,4-dihydro-[1]benzofuro[2,3-c]pyridine? |
| A: CAS number of 7-Bromo-3,4-dihydro-[1]benzofuro[2,3-c]pyridine is 201809-80-5. |
| Q: What is the English name of 7-Bromo-3,4-dihydro-[1]benzofuro[2,3-c]pyridine? |
| A: The English name of 7-Bromo-3,4-dihydro-[1]benzofuro[2,3-c]pyridine is 7-Bromo-3,4-dihydro-[1]benzofuro[2,3-c]pyridine. |