Carbonic acid 4-amino-3-nitro-phenyl ester tert-butyl ester structure
|
Common Name | Carbonic acid 4-amino-3-nitro-phenyl ester tert-butyl ester | ||
|---|---|---|---|---|
| CAS Number | 201811-18-9 | Molecular Weight | 254.23900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H14N2O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | (4-amino-3-nitrophenyl) tert-butyl carbonate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C11H14N2O5 |
|---|---|
| Molecular Weight | 254.23900 |
| Exact Mass | 254.09000 |
| PSA | 107.37000 |
| LogP | 3.59530 |
| InChIKey | GBHDRLLCJYKRJB-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)Oc1ccc(N)c([N+](=O)[O-])c1 |
| HS Code | 2922199090 |
|---|
| HS Code | 2922199090 |
|---|---|
| Summary | 2922199090. other amino-alcohols, other than those containing more than one kind of oxygen function, their ethers and esters; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 4-Amino-3-nitrophenyl tert-butyl carbonate |