(1R,3S)-1-Methyl-3-phenoxybutyl 3-oxobutanoate
Modify Date: 2026-07-08 19:32:45
(1R,3S)-1-Methyl-3-phenoxybutyl 3-oxobutanoate structure
|
Common Name | (1R,3S)-1-Methyl-3-phenoxybutyl 3-oxobutanoate | ||
|---|---|---|---|---|
| CAS Number | 201848-51-3 | Molecular Weight | 264.32 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H20O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | (1R,3S)-1-Methyl-3-phenoxybutyl 3-oxobutanoate |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C15H20O4 |
|---|---|
| Molecular Weight | 264.32 |
| InChIKey | LFGSJIKXEBNATI-QWHCGFSZSA-N |
| SMILES | CC(=O)CC(=O)OC(C)CC(C)Oc1ccccc1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the InChIKey of (1R,3S)-1-Methyl-3-phenoxybutyl 3-oxobutanoate? |
| A: InChIKey of (1R,3S)-1-Methyl-3-phenoxybutyl 3-oxobutanoate is LFGSJIKXEBNATI-QWHCGFSZSA-N. |
| Q: What is the SMILES notation of (1R,3S)-1-Methyl-3-phenoxybutyl 3-oxobutanoate? |
| A: SMILES notation of (1R,3S)-1-Methyl-3-phenoxybutyl 3-oxobutanoate is CC(=O)CC(=O)OC(C)CC(C)Oc1ccccc1. |
| Q: What is the molecular weight of (1R,3S)-1-Methyl-3-phenoxybutyl 3-oxobutanoate? |
| A: Molecular weight of (1R,3S)-1-Methyl-3-phenoxybutyl 3-oxobutanoate is 264.32. |
| Q: What is the English name of (1R,3S)-1-Methyl-3-phenoxybutyl 3-oxobutanoate? |
| A: The English name of (1R,3S)-1-Methyl-3-phenoxybutyl 3-oxobutanoate is (1R,3S)-1-Methyl-3-phenoxybutyl 3-oxobutanoate. |
| Q: What is the CAS number of (1R,3S)-1-Methyl-3-phenoxybutyl 3-oxobutanoate? |
| A: CAS number of (1R,3S)-1-Methyl-3-phenoxybutyl 3-oxobutanoate is 201848-51-3. |
| Q: What is the Chinese name of 201848-51-3? |
| A: Chinese name of 201848-51-3 is 201848-51-3. |
| Q: What is the molecular formula of (1R,3S)-1-Methyl-3-phenoxybutyl 3-oxobutanoate? |
| A: Molecular formula of (1R,3S)-1-Methyl-3-phenoxybutyl 3-oxobutanoate is C15H20O4. |