2-(2,5-Dimethyl-3-thienyl)-4,5-diphenyl-1H-imidazole
Modify Date: 2025-11-06 20:59:05
2-(2,5-Dimethyl-3-thienyl)-4,5-diphenyl-1H-imidazole structure
|
Common Name | 2-(2,5-Dimethyl-3-thienyl)-4,5-diphenyl-1H-imidazole | ||
|---|---|---|---|---|
| CAS Number | 201852-75-7 | Molecular Weight | 330.4 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C21H18N2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2-(2,5-Dimethyl-3-thienyl)-4,5-diphenyl-1H-imidazole |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C21H18N2S |
|---|---|
| Molecular Weight | 330.4 |
| InChIKey | HGLSQTSJOZXREY-UHFFFAOYSA-N |
| SMILES | Cc1cc(-c2nc(-c3ccccc3)c(-c3ccccc3)[nH]2)c(C)s1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the English name of 2-(2,5-Dimethyl-3-thienyl)-4,5-diphenyl-1H-imidazole? |
| A: The English name of 2-(2,5-Dimethyl-3-thienyl)-4,5-diphenyl-1H-imidazole is 2-(2,5-Dimethyl-3-thienyl)-4,5-diphenyl-1H-imidazole. |
| Q: What is the molecular formula of 2-(2,5-Dimethyl-3-thienyl)-4,5-diphenyl-1H-imidazole? |
| A: Molecular formula of 2-(2,5-Dimethyl-3-thienyl)-4,5-diphenyl-1H-imidazole is C21H18N2S. |
| Q: What is the Chinese name of 201852-75-7? |
| A: Chinese name of 201852-75-7 is 201852-75-7. |
| Q: What is the SMILES notation of 2-(2,5-Dimethyl-3-thienyl)-4,5-diphenyl-1H-imidazole? |
| A: SMILES notation of 2-(2,5-Dimethyl-3-thienyl)-4,5-diphenyl-1H-imidazole is Cc1cc(-c2nc(-c3ccccc3)c(-c3ccccc3)[nH]2)c(C)s1. |
| Q: What is the CAS number of 2-(2,5-Dimethyl-3-thienyl)-4,5-diphenyl-1H-imidazole? |
| A: CAS number of 2-(2,5-Dimethyl-3-thienyl)-4,5-diphenyl-1H-imidazole is 201852-75-7. |
| Q: What is the InChIKey of 2-(2,5-Dimethyl-3-thienyl)-4,5-diphenyl-1H-imidazole? |
| A: InChIKey of 2-(2,5-Dimethyl-3-thienyl)-4,5-diphenyl-1H-imidazole is HGLSQTSJOZXREY-UHFFFAOYSA-N. |
| Q: What is the molecular weight of 2-(2,5-Dimethyl-3-thienyl)-4,5-diphenyl-1H-imidazole? |
| A: Molecular weight of 2-(2,5-Dimethyl-3-thienyl)-4,5-diphenyl-1H-imidazole is 330.4. |