1-diphenylphosphorylcyclohexan-1-ol
1-diphenylphosphorylcyclohexan-1-ol structure
|
Common Name | 1-diphenylphosphorylcyclohexan-1-ol | ||
|---|---|---|---|---|
| CAS Number | 20187-71-7 | Molecular Weight | 300.33200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C18H21O2P | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 1-diphenylphosphorylcyclohexan-1-ol |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C18H21O2P |
|---|---|
| Molecular Weight | 300.33200 |
| Exact Mass | 300.12800 |
| PSA | 47.11000 |
| LogP | 3.65320 |
| InChIKey | SXFUMQXJAHMLDS-UHFFFAOYSA-N |
| SMILES | O=P(c1ccccc1)(c1ccccc1)C1(O)CCCCC1 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~32%
1-diphenylphosp... CAS#:20187-71-7 |
| Literature: Nurtdinov, S. Kh.; Kashirskaya, I. M.; Ismagilova, N. M.; Gubaidullina, R. Sh.; Zykova, T. V.; et al. J. Gen. Chem. USSR (Engl. Transl.), 1980 , vol. 50, # 6 p. 1297 - 1301,1049 - 1052 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 2 | |
|---|---|
| DownStream 1 | |
CAS#:13689-20-8This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular weight of 1-diphenylphosphorylcyclohexan-1-ol? |
| A: Molecular weight of 1-diphenylphosphorylcyclohexan-1-ol is 300.33200. |
| Q: What are the upstream materials of 1-diphenylphosphorylcyclohexan-1-ol? |
| A: Related upstream materials(CAS) of 1-diphenylphosphorylcyclohexan-1-ol: 108-94-1;1079-66-9. |
| Q: What is the Chinese name of 20187-71-7? |
| A: Chinese name of 20187-71-7 is 20187-71-7. |
| Q: What is the LogP of 1-diphenylphosphorylcyclohexan-1-ol? |
| A: LogP of 1-diphenylphosphorylcyclohexan-1-ol is 3.65320. |
| Q: What is the CAS number of 1-diphenylphosphorylcyclohexan-1-ol? |
| A: CAS number of 1-diphenylphosphorylcyclohexan-1-ol is 20187-71-7. |
| Q: What is the English name of 1-diphenylphosphorylcyclohexan-1-ol? |
| A: The English name of 1-diphenylphosphorylcyclohexan-1-ol is 1-diphenylphosphorylcyclohexan-1-ol. |
| Q: What is the InChIKey of 1-diphenylphosphorylcyclohexan-1-ol? |
| A: InChIKey of 1-diphenylphosphorylcyclohexan-1-ol is SXFUMQXJAHMLDS-UHFFFAOYSA-N. |
| Q: What is the molecular formula of 1-diphenylphosphorylcyclohexan-1-ol? |
| A: Molecular formula of 1-diphenylphosphorylcyclohexan-1-ol is C18H21O2P. |
| Q: What are the downstream products of 1-diphenylphosphorylcyclohexan-1-ol? |
| A: Related downstream products(CAS) of 1-diphenylphosphorylcyclohexan-1-ol: 13689-20-8. |
| Q: What is the polar surface area (PSA) of 1-diphenylphosphorylcyclohexan-1-ol? |
| A: Polar surface area (PSA) of 1-diphenylphosphorylcyclohexan-1-ol is 47.11000. |