3,5,5-Trimethyl-4-(3-oxo-1-butenyl)-2-cyclohexen-1-one structure
|
Common Name | 3,5,5-Trimethyl-4-(3-oxo-1-butenyl)-2-cyclohexen-1-one | ||
|---|---|---|---|---|
| CAS Number | 20194-68-7 | Molecular Weight | 206.28100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H18O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 3,5,5-trimethyl-4-(3-oxobut-1-enyl)cyclohex-2-en-1-one |
|---|
| Molecular Formula | C13H18O2 |
|---|---|
| Molecular Weight | 206.28100 |
| Exact Mass | 206.13100 |
| PSA | 34.14000 |
| LogP | 2.69310 |
| InChIKey | MLYOGKJJENFVJN-UHFFFAOYSA-N |
| SMILES | CC(=O)C=CC1C(C)=CC(=O)CC1(C)C |
| HS Code | 2914299000 |
|---|
|
~%
3,5,5-Trimethyl... CAS#:20194-68-7 |
| Literature: Liu, Chang-Hui; Li, Fei; Tang, Rui-Ren Bulletin of the Korean Chemical Society, 2010 , vol. 31, # 6 p. 1723 - 1725 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2914299000 |
|---|---|
| Summary | 2914299000. other cyclanic, cyclenic or cyclotherpenic ketones without other oxygen function. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:5.5%. General tariff:30.0% |