2,4-dinitrobenzoyl chloride structure
|
Common Name | 2,4-dinitrobenzoyl chloride | ||
|---|---|---|---|---|
| CAS Number | 20195-22-6 | Molecular Weight | 230.56200 | |
| Density | 1.652g/cm3 | Boiling Point | 352.1ºC at 760 mmHg | |
| Molecular Formula | C7H3ClN2O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 166.7ºC | |
| Name | 2,4-dinitrobenzoyl chloride |
|---|---|
| Synonym | More Synonyms |
| Density | 1.652g/cm3 |
|---|---|
| Boiling Point | 352.1ºC at 760 mmHg |
| Molecular Formula | C7H3ClN2O5 |
| Molecular Weight | 230.56200 |
| Flash Point | 166.7ºC |
| Exact Mass | 229.97300 |
| PSA | 108.71000 |
| LogP | 2.92840 |
| Vapour Pressure | 3.93E-05mmHg at 25°C |
| Index of Refraction | 1.629 |
| InChIKey | HETVWNJEAWTHHK-UHFFFAOYSA-N |
| SMILES | O=C(Cl)c1ccc([N+](=O)[O-])cc1[N+](=O)[O-] |
| HS Code | 2916399090 |
|---|
|
~99%
2,4-dinitrobenz... CAS#:20195-22-6 |
| Literature: Baltina, L. A.; Serdyuk, N. G.; Kondratenko, R. M.; Tolstikov, G. A.; Vasil'eva, E. V. Russian Journal of General Chemistry, 1994 , vol. 64, # 12.2 p. 1809 - 1815 Zhurnal Obshchei Khimii, 1994 , vol. 64, # 12 p. 2040 - 2047 |
| Precursor 1 | |
|---|---|
| DownStream 8 | |
| HS Code | 2916399090 |
|---|---|
| Summary | 2916399090 other aromatic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| 2,4-dinitro-benzoyl chloride |
| EINECS 243-578-1 |
| 2,4-Dinitro-benzoylchlorid |
| 2,4-nitrobenzoyl chloride |