methyl 2-amino-4,5-diethoxybenzoate structure
|
Common Name | methyl 2-amino-4,5-diethoxybenzoate | ||
|---|---|---|---|---|
| CAS Number | 20197-71-1 | Molecular Weight | 239.26800 | |
| Density | 1.136 g/cm3 | Boiling Point | 369ºC at 760 mmHg | |
| Molecular Formula | C12H17NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 161.9ºC | |
| Name | methyl 2-amino-4,5-diethoxybenzoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.136 g/cm3 |
|---|---|
| Boiling Point | 369ºC at 760 mmHg |
| Molecular Formula | C12H17NO4 |
| Molecular Weight | 239.26800 |
| Flash Point | 161.9ºC |
| Exact Mass | 239.11600 |
| PSA | 70.78000 |
| LogP | 2.43400 |
| InChIKey | WYHBJUPMCJWBDD-UHFFFAOYSA-N |
| SMILES | CCOc1cc(N)c(C(=O)OC)cc1OCC |
| HS Code | 2922509090 |
|---|
| HS Code | 2922509090 |
|---|---|
| Summary | 2922509090. other amino-alcohol-phenols, amino-acid-phenols and other amino-compounds with oxygen function. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 4,5-diethoxy-2-aminobenzoic acid methyl ester |
| 2-amino-4,5-diethoxymethylbenzoate |
| Anthranilic acid,4,5-diethoxy-,methyl ester (8CI) |
| Benzoicacid,2-amino-4,5-diethoxy-,methyl ester |
| 3,4-Diaethoxy-6-aminobenzoesaeure-methylester |
| Methyl 3,4-diethoxy-6-aminobenzoate |