3,3'-(((Cyclobutylmethyl)azanediyl)bis(ethane-2,1-diyl))diphenol
Modify Date: 2026-09-22 16:49:37
3,3'-(((Cyclobutylmethyl)azanediyl)bis(ethane-2,1-diyl))diphenol structure
|
Common Name | 3,3'-(((Cyclobutylmethyl)azanediyl)bis(ethane-2,1-diyl))diphenol | ||
|---|---|---|---|---|
| CAS Number | 2019991-21-8 | Molecular Weight | 325.4 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C21H27NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 3,3'-(((Cyclobutylmethyl)azanediyl)bis(ethane-2,1-diyl))diphenol |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C21H27NO2 |
|---|---|
| Molecular Weight | 325.4 |
| InChIKey | KWTDSERCTGJMJW-UHFFFAOYSA-N |
| SMILES | Oc1cccc(CCN(CCc2cccc(O)c2)CC2CCC2)c1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the CAS number of 3,3'-(((Cyclobutylmethyl)azanediyl)bis(ethane-2,1-diyl))diphenol? |
| A: CAS number of 3,3'-(((Cyclobutylmethyl)azanediyl)bis(ethane-2,1-diyl))diphenol is 2019991-21-8. |
| Q: What is the English name of 3,3'-(((Cyclobutylmethyl)azanediyl)bis(ethane-2,1-diyl))diphenol? |
| A: The English name of 3,3'-(((Cyclobutylmethyl)azanediyl)bis(ethane-2,1-diyl))diphenol is 3,3'-(((Cyclobutylmethyl)azanediyl)bis(ethane-2,1-diyl))diphenol. |
| Q: What is the InChIKey of 3,3'-(((Cyclobutylmethyl)azanediyl)bis(ethane-2,1-diyl))diphenol? |
| A: InChIKey of 3,3'-(((Cyclobutylmethyl)azanediyl)bis(ethane-2,1-diyl))diphenol is KWTDSERCTGJMJW-UHFFFAOYSA-N. |
| Q: What is the molecular formula of 3,3'-(((Cyclobutylmethyl)azanediyl)bis(ethane-2,1-diyl))diphenol? |
| A: Molecular formula of 3,3'-(((Cyclobutylmethyl)azanediyl)bis(ethane-2,1-diyl))diphenol is C21H27NO2. |
| Q: What is the SMILES notation of 3,3'-(((Cyclobutylmethyl)azanediyl)bis(ethane-2,1-diyl))diphenol? |
| A: SMILES notation of 3,3'-(((Cyclobutylmethyl)azanediyl)bis(ethane-2,1-diyl))diphenol is Oc1cccc(CCN(CCc2cccc(O)c2)CC2CCC2)c1. |
| Q: What is the Chinese name of 2019991-21-8? |
| A: Chinese name of 2019991-21-8 is 2019991-21-8. |
| Q: What is the molecular weight of 3,3'-(((Cyclobutylmethyl)azanediyl)bis(ethane-2,1-diyl))diphenol? |
| A: Molecular weight of 3,3'-(((Cyclobutylmethyl)azanediyl)bis(ethane-2,1-diyl))diphenol is 325.4. |