Ethyl 2-cyano-2-(3,5-dibromophenyl)acetate
Modify Date: 2026-10-09 21:47:34
Ethyl 2-cyano-2-(3,5-dibromophenyl)acetate structure
|
Common Name | Ethyl 2-cyano-2-(3,5-dibromophenyl)acetate | ||
|---|---|---|---|---|
| CAS Number | 202000-93-9 | Molecular Weight | 347.00 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H9Br2NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Ethyl 2-cyano-2-(3,5-dibromophenyl)acetate |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C11H9Br2NO2 |
|---|---|
| Molecular Weight | 347.00 |
| InChIKey | VRQNYTLGSOXMHM-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(C#N)c1cc(Br)cc(Br)c1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular formula of Ethyl 2-cyano-2-(3,5-dibromophenyl)acetate? |
| A: Molecular formula of Ethyl 2-cyano-2-(3,5-dibromophenyl)acetate is C11H9Br2NO2. |
| Q: What is the Chinese name of 202000-93-9? |
| A: Chinese name of 202000-93-9 is 202000-93-9. |
| Q: What is the InChIKey of Ethyl 2-cyano-2-(3,5-dibromophenyl)acetate? |
| A: InChIKey of Ethyl 2-cyano-2-(3,5-dibromophenyl)acetate is VRQNYTLGSOXMHM-UHFFFAOYSA-N. |
| Q: What is the molecular weight of Ethyl 2-cyano-2-(3,5-dibromophenyl)acetate? |
| A: Molecular weight of Ethyl 2-cyano-2-(3,5-dibromophenyl)acetate is 347.00. |
| Q: What is the CAS number of Ethyl 2-cyano-2-(3,5-dibromophenyl)acetate? |
| A: CAS number of Ethyl 2-cyano-2-(3,5-dibromophenyl)acetate is 202000-93-9. |
| Q: What is the English name of Ethyl 2-cyano-2-(3,5-dibromophenyl)acetate? |
| A: The English name of Ethyl 2-cyano-2-(3,5-dibromophenyl)acetate is Ethyl 2-cyano-2-(3,5-dibromophenyl)acetate. |
| Q: What is the SMILES notation of Ethyl 2-cyano-2-(3,5-dibromophenyl)acetate? |
| A: SMILES notation of Ethyl 2-cyano-2-(3,5-dibromophenyl)acetate is CCOC(=O)C(C#N)c1cc(Br)cc(Br)c1. |