(2-chloro-4-nitrophenyl) thiohypochlorite
(2-chloro-4-nitrophenyl) thiohypochlorite structure
|
Common Name | (2-chloro-4-nitrophenyl) thiohypochlorite | ||
|---|---|---|---|---|
| CAS Number | 20201-06-3 | Molecular Weight | 224.06500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C6H3Cl2NO2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | (2-chloro-4-nitrophenyl) thiohypochlorite |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C6H3Cl2NO2S |
|---|---|
| Molecular Weight | 224.06500 |
| Exact Mass | 222.92600 |
| PSA | 71.12000 |
| LogP | 4.01730 |
| InChIKey | RQCHGROTARKLQK-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1ccc(SCl)c(Cl)c1 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~%
(2-chloro-4-nit... CAS#:20201-06-3 |
| Literature: Frankovskii,Ch.S.; Katsnel'son,E.Z. Journal of Organic Chemistry USSR (English Translation), 1968 , vol. 4, p. 478 - 481 Zhurnal Organicheskoi Khimii, 1968 , vol. 4, # 3 p. 490 - 493 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 1 | |
|---|---|
| DownStream 0 | |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 2-chloro-4-nitro-benzenesulfenyl chloride |
| Benzenesulfenyl chloride,2-chloro-4-nitro |
| 2-Chlor-4-nitro-1-chlorsulfenyl-benzol |
| 2-Chlor-4-nitro-benzolsulfenylchlorid |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the SMILES notation of (2-chloro-4-nitrophenyl) thiohypochlorite? |
| A: SMILES notation of (2-chloro-4-nitrophenyl) thiohypochlorite is O=[N+]([O-])c1ccc(SCl)c(Cl)c1. |
| Q: What is the English name of (2-chloro-4-nitrophenyl) thiohypochlorite? |
| A: The English name of (2-chloro-4-nitrophenyl) thiohypochlorite is (2-chloro-4-nitrophenyl) thiohypochlorite. |
| Q: What is the Chinese name of 20201-06-3? |
| A: Chinese name of 20201-06-3 is 20201-06-3. |
| Q: What is the molecular weight of (2-chloro-4-nitrophenyl) thiohypochlorite? |
| A: Molecular weight of (2-chloro-4-nitrophenyl) thiohypochlorite is 224.06500. |
| Q: What is the LogP of (2-chloro-4-nitrophenyl) thiohypochlorite? |
| A: LogP of (2-chloro-4-nitrophenyl) thiohypochlorite is 4.01730. |
| Q: What is the InChIKey of (2-chloro-4-nitrophenyl) thiohypochlorite? |
| A: InChIKey of (2-chloro-4-nitrophenyl) thiohypochlorite is RQCHGROTARKLQK-UHFFFAOYSA-N. |
| Q: What is the CAS number of (2-chloro-4-nitrophenyl) thiohypochlorite? |
| A: CAS number of (2-chloro-4-nitrophenyl) thiohypochlorite is 20201-06-3. |
| Q: What is the polar surface area (PSA) of (2-chloro-4-nitrophenyl) thiohypochlorite? |
| A: Polar surface area (PSA) of (2-chloro-4-nitrophenyl) thiohypochlorite is 71.12000. |
| Q: What are the upstream materials of (2-chloro-4-nitrophenyl) thiohypochlorite? |
| A: Related upstream materials(CAS) of (2-chloro-4-nitrophenyl) thiohypochlorite: 20201-04-1. |
| Q: What English synonyms does (2-chloro-4-nitrophenyl) thiohypochlorite have? |
| A: English synonyms of (2-chloro-4-nitrophenyl) thiohypochlorite: 2-chloro-4-nitro-benzenesulfenyl chloride, Benzenesulfenyl chloride,2-chloro-4-nitro, 2-Chlor-4-nitro-1-chlorsulfenyl-benzol, 2-Chlor-4-nitro-benzolsulfenylchlorid. |