6,7,9,10,12,13-Hexamethoxyoctadecanoic acid methyl ester structure
|
Common Name | 6,7,9,10,12,13-Hexamethoxyoctadecanoic acid methyl ester | ||
|---|---|---|---|---|
| CAS Number | 20207-68-5 | Molecular Weight | 478.66000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C25H50O8 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | methyl 6,7,9,10,12,13-hexamethoxyoctadecanoate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C25H50O8 |
|---|---|
| Molecular Weight | 478.66000 |
| Exact Mass | 478.35100 |
| PSA | 81.68000 |
| LogP | 4.17030 |
| InChIKey | BSUPGHZUWDWANW-UHFFFAOYSA-N |
| SMILES | CCCCCC(OC)C(CC(OC)C(CC(OC)C(CCCCC(=O)OC)OC)OC)OC |
| HS Code | 2918990090 |
|---|
| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 6,7,9,10,12,13-Hexamethoxyoctadecanoic acid methyl ester |
| Octadecanoic acid,6,7,9,10,12,13-hexamethoxy-,methyl ester |