5-(benzylsulfanylmethyl)imidazolidine-2,4-dione
Modify Date: 2025-08-23 12:31:28
5-(benzylsulfanylmethyl)imidazolidine-2,4-dione structure
|
Common Name | 5-(benzylsulfanylmethyl)imidazolidine-2,4-dione | ||
|---|---|---|---|---|
| CAS Number | 20210-01-9 | Molecular Weight | 236.29000 | |
| Density | 1.27g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C11H12N2O2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 5-(benzylsulfanylmethyl)imidazolidine-2,4-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.27g/cm3 |
|---|---|
| Molecular Formula | C11H12N2O2S |
| Molecular Weight | 236.29000 |
| Exact Mass | 236.06200 |
| PSA | 90.48000 |
| LogP | 1.04370 |
| Index of Refraction | 1.588 |
| InChIKey | LKPYNTOXZAIDCX-UHFFFAOYSA-N |
| SMILES | O=C1NC(=O)C(CSCc2ccccc2)N1 |
| HS Code | 2933990090 |
|---|
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 5-BzSMe hydantoin |
| 5-benzylsulfanylmethylhydantoin |
| 5-benzylsulfanylmethyl-imidazolidine-2,4-dione |
| S-benzyl-D,L-cysteine hydantoin |
| 5-Benzylmercapto-methyl-hydantoin |