methyl 4-amino-3-chloro-5-methylbenzoate structure
|
Common Name | methyl 4-amino-3-chloro-5-methylbenzoate | ||
|---|---|---|---|---|
| CAS Number | 202146-16-5 | Molecular Weight | 199.63400 | |
| Density | 1.264±0.06 g/cm3(Predicted) | Boiling Point | 342.0±37.0 °C(Predicted) | |
| Molecular Formula | C9H10ClNO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | methyl 4-amino-3-chloro-5-methylbenzoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.264±0.06 g/cm3(Predicted) |
|---|---|
| Boiling Point | 342.0±37.0 °C(Predicted) |
| Molecular Formula | C9H10ClNO2 |
| Molecular Weight | 199.63400 |
| Exact Mass | 199.04000 |
| PSA | 52.32000 |
| LogP | 2.59840 |
| InChIKey | SDBXHTMFAXKDML-UHFFFAOYSA-N |
| SMILES | COC(=O)c1cc(C)c(N)c(Cl)c1 |
| HS Code | 2922499990 |
|---|
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2922499990 |
|---|---|
| Summary | HS:2922499990 other amino-acids, other than those containing more than one kind of oxygen function, and their esters; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward) MFN tariff:6.5% General tariff:30.0% |
| methyl 4-amino-5-chloro-3-methylbenzoate |
| OR0597 |