Ethyl 4-oxo-1,4,5,6,7,8-hexahydrocyclohepta[B]pyrrole-3-carboxylate
Modify Date: 2025-09-26 08:02:43
![Ethyl 4-oxo-1,4,5,6,7,8-hexahydrocyclohepta[B]pyrrole-3-carboxylate Structure](https://www.chemsrc.com/extcaspic/217/202209-74-3.png)
Ethyl 4-oxo-1,4,5,6,7,8-hexahydrocyclohepta[B]pyrrole-3-carboxylate structure
|
Common Name | Ethyl 4-oxo-1,4,5,6,7,8-hexahydrocyclohepta[B]pyrrole-3-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 202209-74-3 | Molecular Weight | 221.25 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H15NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Ethyl 4-oxo-1,4,5,6,7,8-hexahydrocyclohepta[B]pyrrole-3-carboxylate |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C12H15NO3 |
|---|---|
| Molecular Weight | 221.25 |
| InChIKey | PQLOIWYFDWGKSQ-UHFFFAOYSA-N |
| SMILES | CCOC(=O)c1c[nH]c2c1C(=O)CCCC2 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the SMILES notation of Ethyl 4-oxo-1,4,5,6,7,8-hexahydrocyclohepta[B]pyrrole-3-carboxylate? |
| A: SMILES notation of Ethyl 4-oxo-1,4,5,6,7,8-hexahydrocyclohepta[B]pyrrole-3-carboxylate is CCOC(=O)c1c[nH]c2c1C(=O)CCCC2. |
| Q: What is the molecular formula of Ethyl 4-oxo-1,4,5,6,7,8-hexahydrocyclohepta[B]pyrrole-3-carboxylate? |
| A: Molecular formula of Ethyl 4-oxo-1,4,5,6,7,8-hexahydrocyclohepta[B]pyrrole-3-carboxylate is C12H15NO3. |
| Q: What is the CAS number of Ethyl 4-oxo-1,4,5,6,7,8-hexahydrocyclohepta[B]pyrrole-3-carboxylate? |
| A: CAS number of Ethyl 4-oxo-1,4,5,6,7,8-hexahydrocyclohepta[B]pyrrole-3-carboxylate is 202209-74-3. |
| Q: What is the InChIKey of Ethyl 4-oxo-1,4,5,6,7,8-hexahydrocyclohepta[B]pyrrole-3-carboxylate? |
| A: InChIKey of Ethyl 4-oxo-1,4,5,6,7,8-hexahydrocyclohepta[B]pyrrole-3-carboxylate is PQLOIWYFDWGKSQ-UHFFFAOYSA-N. |
| Q: What is the Chinese name of 202209-74-3? |
| A: Chinese name of 202209-74-3 is 202209-74-3. |
| Q: What is the English name of Ethyl 4-oxo-1,4,5,6,7,8-hexahydrocyclohepta[B]pyrrole-3-carboxylate? |
| A: The English name of Ethyl 4-oxo-1,4,5,6,7,8-hexahydrocyclohepta[B]pyrrole-3-carboxylate is Ethyl 4-oxo-1,4,5,6,7,8-hexahydrocyclohepta[B]pyrrole-3-carboxylate. |
| Q: What is the molecular weight of Ethyl 4-oxo-1,4,5,6,7,8-hexahydrocyclohepta[B]pyrrole-3-carboxylate? |
| A: Molecular weight of Ethyl 4-oxo-1,4,5,6,7,8-hexahydrocyclohepta[B]pyrrole-3-carboxylate is 221.25. |