Furo(3,4-b)furan-2,6(3H,4H)-dione, dihydro-3-methylene-4-octyl- (VAN) (8CI) structure
|
Common Name | Furo(3,4-b)furan-2,6(3H,4H)-dione, dihydro-3-methylene-4-octyl- (VAN) (8CI) | ||
|---|---|---|---|---|
| CAS Number | 20223-76-1 | Molecular Weight | 266.33300 | |
| Density | 1.1g/cm3 | Boiling Point | 458.2ºC at 760 mmHg | |
| Molecular Formula | C15H22O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 235.3ºC | |
| Name | (-)-Avenaciolide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.1g/cm3 |
|---|---|
| Boiling Point | 458.2ºC at 760 mmHg |
| Molecular Formula | C15H22O4 |
| Molecular Weight | 266.33300 |
| Flash Point | 235.3ºC |
| Exact Mass | 266.15200 |
| PSA | 52.60000 |
| LogP | 2.76020 |
| Vapour Pressure | 1.4E-08mmHg at 25°C |
| Index of Refraction | 1.495 |
| InChIKey | GSTQYRQXFPSWSH-JHJVBQTASA-N |
| SMILES | C=C1C(=O)OC2C(=O)OC(CCCCCCCC)C12 |
| HS Code | 2932999099 |
|---|
| HS Code | 2932999099 |
|---|---|
| Summary | 2932999099. other heterocyclic compounds with oxygen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| avenaciolide |