H-Asp(His-OH)-OH structure
|
Common Name | H-Asp(His-OH)-OH | ||
|---|---|---|---|---|
| CAS Number | 20223-80-7 | Molecular Weight | 270.24200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H14N4O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of H-Asp(His-OH)-OHBeta-Asp-His is a dipeptide containing aspartic acid and histidine, which can form amino acid derivatives by complexing with Zinc[1]. |
| Name | H-Asp(His-OH)-OH |
|---|---|
| Synonym | More Synonyms |
| Description | Beta-Asp-His is a dipeptide containing aspartic acid and histidine, which can form amino acid derivatives by complexing with Zinc[1]. |
|---|---|
| Related Catalog | |
| References |
| Molecular Formula | C10H14N4O5 |
|---|---|
| Molecular Weight | 270.24200 |
| Exact Mass | 270.09600 |
| PSA | 158.40000 |
| InChIKey | KABYBYFUSGXITA-BQBZGAKWSA-N |
| SMILES | NC(CC(=O)NC(Cc1cnc[nH]1)C(=O)O)C(=O)O |
| H-b-Asp-His-OH |
| B-asp-his |