3-Amino-3-{2-[(tert-butoxy)carbonyl]-2-azabicyclo[2.1.1]hexan-5-yl}butanoic acid
Modify Date: 2025-09-23 19:18:42
![3-Amino-3-{2-[(tert-butoxy)carbonyl]-2-azabicyclo[2.1.1]hexan-5-yl}butanoic acid Structure](https://www.chemsrc.com/extcaspic/281/2022497-06-7.png)
3-Amino-3-{2-[(tert-butoxy)carbonyl]-2-azabicyclo[2.1.1]hexan-5-yl}butanoic acid structure
|
Common Name | 3-Amino-3-{2-[(tert-butoxy)carbonyl]-2-azabicyclo[2.1.1]hexan-5-yl}butanoic acid | ||
|---|---|---|---|---|
| CAS Number | 2022497-06-7 | Molecular Weight | 284.35 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H24N2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 3-Amino-3-{2-[(tert-butoxy)carbonyl]-2-azabicyclo[2.1.1]hexan-5-yl}butanoic acid |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C14H24N2O4 |
|---|---|
| Molecular Weight | 284.35 |
| InChIKey | XUSZYIBRDJYJAQ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC2CC1C2C(C)(N)CC(=O)O |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the InChIKey of 3-Amino-3-{2-[(tert-butoxy)carbonyl]-2-azabicyclo[2.1.1]hexan-5-yl}butanoic acid? |
| A: InChIKey of 3-Amino-3-{2-[(tert-butoxy)carbonyl]-2-azabicyclo[2.1.1]hexan-5-yl}butanoic acid is XUSZYIBRDJYJAQ-UHFFFAOYSA-N. |
| Q: What is the molecular weight of 3-Amino-3-{2-[(tert-butoxy)carbonyl]-2-azabicyclo[2.1.1]hexan-5-yl}butanoic acid? |
| A: Molecular weight of 3-Amino-3-{2-[(tert-butoxy)carbonyl]-2-azabicyclo[2.1.1]hexan-5-yl}butanoic acid is 284.35. |
| Q: What is the molecular formula of 3-Amino-3-{2-[(tert-butoxy)carbonyl]-2-azabicyclo[2.1.1]hexan-5-yl}butanoic acid? |
| A: Molecular formula of 3-Amino-3-{2-[(tert-butoxy)carbonyl]-2-azabicyclo[2.1.1]hexan-5-yl}butanoic acid is C14H24N2O4. |
| Q: What is the English name of 3-Amino-3-{2-[(tert-butoxy)carbonyl]-2-azabicyclo[2.1.1]hexan-5-yl}butanoic acid? |
| A: The English name of 3-Amino-3-{2-[(tert-butoxy)carbonyl]-2-azabicyclo[2.1.1]hexan-5-yl}butanoic acid is 3-Amino-3-{2-[(tert-butoxy)carbonyl]-2-azabicyclo[2.1.1]hexan-5-yl}butanoic acid. |
| Q: What is the SMILES notation of 3-Amino-3-{2-[(tert-butoxy)carbonyl]-2-azabicyclo[2.1.1]hexan-5-yl}butanoic acid? |
| A: SMILES notation of 3-Amino-3-{2-[(tert-butoxy)carbonyl]-2-azabicyclo[2.1.1]hexan-5-yl}butanoic acid is CC(C)(C)OC(=O)N1CC2CC1C2C(C)(N)CC(=O)O. |
| Q: What is the Chinese name of 2022497-06-7? |
| A: Chinese name of 2022497-06-7 is 2022497-06-7. |
| Q: What is the CAS number of 3-Amino-3-{2-[(tert-butoxy)carbonyl]-2-azabicyclo[2.1.1]hexan-5-yl}butanoic acid? |
| A: CAS number of 3-Amino-3-{2-[(tert-butoxy)carbonyl]-2-azabicyclo[2.1.1]hexan-5-yl}butanoic acid is 2022497-06-7. |