(+)-Potassium Ds-threo-isocitrate monobasic structure
|
Common Name | (+)-Potassium Ds-threo-isocitrate monobasic | ||
|---|---|---|---|---|
| CAS Number | 20226-99-7 | Molecular Weight | 230.21400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C6H7KO7 | Melting Point | ~185℃ (dec.) | |
| MSDS | USA | Flash Point | N/A | |
| Name | potassium,(2S,3R)-2-(carboxymethyl)-3,4-dihydroxy-4-oxobutanoate |
|---|---|
| Synonym | More Synonyms |
| Melting Point | ~185℃ (dec.) |
|---|---|
| Molecular Formula | C6H7KO7 |
| Molecular Weight | 230.21400 |
| Exact Mass | 229.98300 |
| PSA | 134.96000 |
| Vapour Pressure | 1.3E-05mmHg at 25°C |
| InChIKey | IVLPTBJBFVJENN-LEJBHHMKSA-M |
| SMILES | O=C(O)CC(C(=O)O)C(O)C(=O)[O-].[K+] |
| Storage condition | 2-8℃ |
| Personal Protective Equipment | Eyeshields;Gloves;type N95 (US);type P1 (EN143) respirator filter |
|---|---|
| RIDADR | NONH for all modes of transport |
| HS Code | 2918199090 |
| HS Code | 2918199090 |
|---|---|
| Summary | 2918199090 other carboxylic acids with alcohol function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
|
A highly stable NADP-dependent isocitrate dehydrogenase from Thermus thermophilus HB8: purification and general properties.
Biochim. Biophys. Acta 990 , 133, (1989) NADP-dependent isocitrate dehydrogenase (EC 1.1.1.42) was purified to electrophoretic homogeneity from an extremely thermophilic bacterium, Thermus thermophilus HB8, and shown to be a dimeric protein ... |
| (1R,2S)-1-Hydroxy-1,2,3-propanetricarboxylic acid monopotassium salt |
| Isocitricacid,monopotassium salt (8CI) |
| Ds-(+)-threo-Isocitric acid monopotassium salt |
| (+)-Potassium Ds-threo-isocitrate monobasic |
| L-Isocitric acid |
| Monopotassium D-Isocitrate |