3-[(3,4-dimethoxyphenyl)methyl]-6,7-dimethoxy-3,4-dihydroisoquinoline structure
|
Common Name | 3-[(3,4-dimethoxyphenyl)methyl]-6,7-dimethoxy-3,4-dihydroisoquinoline | ||
|---|---|---|---|---|
| CAS Number | 20232-49-9 | Molecular Weight | 341.40100 | |
| Density | 1.15g/cm3 | Boiling Point | 490.5ºC at 760 mmHg | |
| Molecular Formula | C20H23NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 200.6ºC | |
| Name | 3-[(3,4-dimethoxyphenyl)methyl]-6,7-dimethoxy-3,4-dihydroisoquinoline |
|---|---|
| Synonym | More Synonyms |
| Density | 1.15g/cm3 |
|---|---|
| Boiling Point | 490.5ºC at 760 mmHg |
| Molecular Formula | C20H23NO4 |
| Molecular Weight | 341.40100 |
| Flash Point | 200.6ºC |
| Exact Mass | 341.16300 |
| PSA | 49.28000 |
| LogP | 2.74290 |
| Vapour Pressure | 2.74E-09mmHg at 25°C |
| Index of Refraction | 1.554 |
| InChIKey | DJBQMOKXDOEAAA-UHFFFAOYSA-N |
| SMILES | COc1ccc(CC2Cc3cc(OC)c(OC)cc3C=N2)cc1OC |
| HS Code | 2933499090 |
|---|
| HS Code | 2933499090 |
|---|---|
| Summary | 2933499090. other compounds containing in the structure a quinoline or isoquinoline ring-system (whether or not hydrogenated), not further fused. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 3-(3,4-dimethoxybenzyl)-6,7-dimethoxy-3,4-dihydroisoquinoline |
| 6,7-dimethoxy-3-veratryl-3,4-dihydro-isoquinoline |
| 6,7-Dimethoxy-3-veratryl-3,4-dihydro-isochinolin |
| 3-(3,4-Dimethoxy-benzyl)-6,7-dimethoxy-3,4-dihydro-isochinolin |
| ISOQUINOLINE,3,4-DIHYDRO-6,7-DIMETHOXY-3-VERATRYL |
| 3,4-Dihydro-6,7-dimethoxy-3-veratrylisoquinoline |
| 6,7-Dimethoxy-3-(3',4'-dimethoxybenzyl)-3,4-dihydroisochinolin |