2,6-bis(4-azidobenzylidene)cyclohexanone
2,6-bis(4-azidobenzylidene)cyclohexanone structure
|
Common Name | 2,6-bis(4-azidobenzylidene)cyclohexanone | ||
|---|---|---|---|---|
| CAS Number | 20237-98-3 | Molecular Weight | 356.38100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C20H16N6O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2,6-bis[(4-azidophenyl)methylidene]cyclohexan-1-one |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C20H16N6O |
|---|---|
| Molecular Weight | 356.38100 |
| Exact Mass | 356.13900 |
| PSA | 116.57000 |
| LogP | 5.69572 |
| InChIKey | UZNOMHUYXSAUPB-UNZYHPAISA-N |
| SMILES | [N-]=[N+]=Nc1ccc(C=C2CCCC(=Cc3ccc(N=[N+]=[N-])cc3)C2=O)cc1 |
This table provides MSDS information including hazard classification, first‑aid, fire‑fighting, spill handling, operation and storage instructions.
This table covers safety warnings, protective measures, incompatible substances and disposal guidelines for this compound.
| RIDADR | 1325 |
|---|---|
| Packaging Group | III |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 2,4-PENTANEDIOL DIACETATE---CLEAR LIQUID |
| EINECS 243-625-6 |
| 2,6-Bis(4-azidobenzylidene)cyclohexanone |
| 2,6-Di(4-azidobenzal)cyclohexanone |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the LogP of 2,6-bis[(4-azidophenyl)methylidene]cyclohexan-1-one? |
| A: LogP of 2,6-bis[(4-azidophenyl)methylidene]cyclohexan-1-one is 5.69572. |
| Q: What is the molecular formula of 2,6-bis[(4-azidophenyl)methylidene]cyclohexan-1-one? |
| A: Molecular formula of 2,6-bis[(4-azidophenyl)methylidene]cyclohexan-1-one is C20H16N6O. |
| Q: What is the InChIKey of 2,6-bis[(4-azidophenyl)methylidene]cyclohexan-1-one? |
| A: InChIKey of 2,6-bis[(4-azidophenyl)methylidene]cyclohexan-1-one is UZNOMHUYXSAUPB-UNZYHPAISA-N. |
| Q: What is the CAS number of 2,6-bis[(4-azidophenyl)methylidene]cyclohexan-1-one? |
| A: CAS number of 2,6-bis[(4-azidophenyl)methylidene]cyclohexan-1-one is 20237-98-3. |
| Q: What is the SMILES notation of 2,6-bis[(4-azidophenyl)methylidene]cyclohexan-1-one? |
| A: SMILES notation of 2,6-bis[(4-azidophenyl)methylidene]cyclohexan-1-one is [N-]=[N+]=Nc1ccc(C=C2CCCC(=Cc3ccc(N=[N+]=[N-])cc3)C2=O)cc1. |
| Q: What English synonyms does 2,6-bis[(4-azidophenyl)methylidene]cyclohexan-1-one have? |
| A: English synonyms of 2,6-bis[(4-azidophenyl)methylidene]cyclohexan-1-one: 2,4-PENTANEDIOL DIACETATE---CLEAR LIQUID, EINECS 243-625-6, 2,6-Bis(4-azidobenzylidene)cyclohexanone, 2,6-Di(4-azidobenzal)cyclohexanone. |
| Q: What is the polar surface area (PSA) of 2,6-bis[(4-azidophenyl)methylidene]cyclohexan-1-one? |
| A: Polar surface area (PSA) of 2,6-bis[(4-azidophenyl)methylidene]cyclohexan-1-one is 116.57000. |
| Q: What is the English name of 2,6-bis[(4-azidophenyl)methylidene]cyclohexan-1-one? |
| A: The English name of 2,6-bis[(4-azidophenyl)methylidene]cyclohexan-1-one is 2,6-bis[(4-azidophenyl)methylidene]cyclohexan-1-one. |
| Q: What is the molecular weight of 2,6-bis[(4-azidophenyl)methylidene]cyclohexan-1-one? |
| A: Molecular weight of 2,6-bis[(4-azidophenyl)methylidene]cyclohexan-1-one is 356.38100. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |
| Dayang Chem (Hangzhou) Co., Ltd. |