(S)-3-{2-[(R)-2-Oxo-3-(2-piperidin-4-yl-ethyl)-piperidin-1-yl]-acetylamino}-3-pyridin-3-yl-propionic acid
Modify Date: 2026-04-18 23:12:05
![(S)-3-{2-[(R)-2-Oxo-3-(2-piperidin-4-yl-ethyl)-piperidin-1-yl]-acetylamino}-3-pyridin-3-yl-propionic acid Structure](https://www.chemsrc.com/extcaspic/307/202468-72-2.png)
(S)-3-{2-[(R)-2-Oxo-3-(2-piperidin-4-yl-ethyl)-piperidin-1-yl]-acetylamino}-3-pyridin-3-yl-propionic acid structure
|
Common Name | (S)-3-{2-[(R)-2-Oxo-3-(2-piperidin-4-yl-ethyl)-piperidin-1-yl]-acetylamino}-3-pyridin-3-yl-propionic acid | ||
|---|---|---|---|---|
| CAS Number | 202468-72-2 | Molecular Weight | 416.5 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C22H32N4O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | (S)-3-{2-[(R)-2-Oxo-3-(2-piperidin-4-yl-ethyl)-piperidin-1-yl]-acetylamino}-3-pyridin-3-yl-propionic acid |
|---|
| Molecular Formula | C22H32N4O4 |
|---|---|
| Molecular Weight | 416.5 |
| InChIKey | BSXTXDDIXVXJQU-HKUYNNGSSA-N |
| SMILES | C1C[C@H](C(=O)N(C1)CC(=O)N[C@@H](CC(=O)O)C2=CN=CC=C2)CCC3CCNCC3 |
|
Name: Selectivity as determined by the ratio of KDs, resting receptor over activated recept...
Source: ChEMBL
Target: Integrin alpha-IIb
External Id: CHEMBL839037
|
|
Name: Inhibition of aggregation of human gel-filtered platelets measured by light transmitt...
Source: ChEMBL
Target: Integrin alpha-IIb
External Id: CHEMBL841418
|
|
Name: Competition with [1251]L-692,884 for binding to purified alpha IIb/beta3 integrin, ac...
Source: ChEMBL
Target: Integrin alpha-IIb
External Id: CHEMBL821404
|
|
Name: Binding affinity to resting form of alpha IIb/beta3 integrin by flow cytometry using ...
Source: ChEMBL
Target: Integrin alpha-IIb
External Id: CHEMBL824387
|
Total 4, Current Page 1 of 1
1