1,4-Cyclohexanedimethanol bis(3,4-epoxycyclohexanecarboxylate) structure
|
Common Name | 1,4-Cyclohexanedimethanol bis(3,4-epoxycyclohexanecarboxylate) | ||
|---|---|---|---|---|
| CAS Number | 20249-12-1 | Molecular Weight | 392.48600 | |
| Density | 1.203 | Boiling Point | 504.3ºC at 760 mmHg | |
| Molecular Formula | C22H32O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 218.5ºC | |
| Name | 1,4-Cyclohexanedimethanol bis(3,4-epoxycyclohexanecarboxylate) |
|---|
| Density | 1.203 |
|---|---|
| Boiling Point | 504.3ºC at 760 mmHg |
| Molecular Formula | C22H32O6 |
| Molecular Weight | 392.48600 |
| Flash Point | 218.5ºC |
| Exact Mass | 392.22000 |
| PSA | 77.66000 |
| LogP | 3.01420 |
| Vapour Pressure | 2.7E-10mmHg at 25°C |
| Index of Refraction | 1.526 |
| InChIKey | NRJLSUZLHMXXHJ-UHFFFAOYSA-N |
| SMILES | O=C(OCC1CCC(COC(=O)C2CCC3OC3C2)CC1)C1CCC2OC2C1 |
| HS Code | 2932999099 |
|---|
| HS Code | 2932999099 |
|---|---|
| Summary | 2932999099. other heterocyclic compounds with oxygen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |