N-(3-amino-1,1,1-trifluoropropan-2-yl)-2-(dimethylamino)acetamide
Modify Date: 2025-09-02 19:30:47
N-(3-amino-1,1,1-trifluoropropan-2-yl)-2-(dimethylamino)acetamide structure
|
Common Name | N-(3-amino-1,1,1-trifluoropropan-2-yl)-2-(dimethylamino)acetamide | ||
|---|---|---|---|---|
| CAS Number | 2024903-98-6 | Molecular Weight | 213.20 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C7H14F3N3O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | N-(3-amino-1,1,1-trifluoropropan-2-yl)-2-(dimethylamino)acetamide |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C7H14F3N3O |
|---|---|
| Molecular Weight | 213.20 |
| InChIKey | PJZNIZVAFYJGBK-UHFFFAOYSA-N |
| SMILES | CN(C)CC(=O)NC(CN)C(F)(F)F |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the CAS number of N-(3-amino-1,1,1-trifluoropropan-2-yl)-2-(dimethylamino)acetamide? |
| A: CAS number of N-(3-amino-1,1,1-trifluoropropan-2-yl)-2-(dimethylamino)acetamide is 2024903-98-6. |
| Q: What is the English name of N-(3-amino-1,1,1-trifluoropropan-2-yl)-2-(dimethylamino)acetamide? |
| A: The English name of N-(3-amino-1,1,1-trifluoropropan-2-yl)-2-(dimethylamino)acetamide is N-(3-amino-1,1,1-trifluoropropan-2-yl)-2-(dimethylamino)acetamide. |
| Q: What is the molecular formula of N-(3-amino-1,1,1-trifluoropropan-2-yl)-2-(dimethylamino)acetamide? |
| A: Molecular formula of N-(3-amino-1,1,1-trifluoropropan-2-yl)-2-(dimethylamino)acetamide is C7H14F3N3O. |
| Q: What is the molecular weight of N-(3-amino-1,1,1-trifluoropropan-2-yl)-2-(dimethylamino)acetamide? |
| A: Molecular weight of N-(3-amino-1,1,1-trifluoropropan-2-yl)-2-(dimethylamino)acetamide is 213.20. |
| Q: What is the InChIKey of N-(3-amino-1,1,1-trifluoropropan-2-yl)-2-(dimethylamino)acetamide? |
| A: InChIKey of N-(3-amino-1,1,1-trifluoropropan-2-yl)-2-(dimethylamino)acetamide is PJZNIZVAFYJGBK-UHFFFAOYSA-N. |
| Q: What is the Chinese name of 2024903-98-6? |
| A: Chinese name of 2024903-98-6 is 2024903-98-6. |
| Q: What is the SMILES notation of N-(3-amino-1,1,1-trifluoropropan-2-yl)-2-(dimethylamino)acetamide? |
| A: SMILES notation of N-(3-amino-1,1,1-trifluoropropan-2-yl)-2-(dimethylamino)acetamide is CN(C)CC(=O)NC(CN)C(F)(F)F. |