Rel-(3R,4S)-4-((3-chloro-4-fluorophenyl)amino)tetrahydrofuran-3-ol
Modify Date: 2026-07-06 20:51:16
Rel-(3R,4S)-4-((3-chloro-4-fluorophenyl)amino)tetrahydrofuran-3-ol structure
|
Common Name | Rel-(3R,4S)-4-((3-chloro-4-fluorophenyl)amino)tetrahydrofuran-3-ol | ||
|---|---|---|---|---|
| CAS Number | 2024906-45-2 | Molecular Weight | 231.65 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H11ClFNO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Rel-(3R,4S)-4-((3-chloro-4-fluorophenyl)amino)tetrahydrofuran-3-ol |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C10H11ClFNO2 |
|---|---|
| Molecular Weight | 231.65 |
| InChIKey | CZEOCSVAJDCVLW-UWVGGRQHSA-N |
| SMILES | OC1COCC1Nc1ccc(F)c(Cl)c1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the SMILES notation of Rel-(3R,4S)-4-((3-chloro-4-fluorophenyl)amino)tetrahydrofuran-3-ol? |
| A: SMILES notation of Rel-(3R,4S)-4-((3-chloro-4-fluorophenyl)amino)tetrahydrofuran-3-ol is OC1COCC1Nc1ccc(F)c(Cl)c1. |
| Q: What is the English name of Rel-(3R,4S)-4-((3-chloro-4-fluorophenyl)amino)tetrahydrofuran-3-ol? |
| A: The English name of Rel-(3R,4S)-4-((3-chloro-4-fluorophenyl)amino)tetrahydrofuran-3-ol is Rel-(3R,4S)-4-((3-chloro-4-fluorophenyl)amino)tetrahydrofuran-3-ol. |
| Q: What is the CAS number of Rel-(3R,4S)-4-((3-chloro-4-fluorophenyl)amino)tetrahydrofuran-3-ol? |
| A: CAS number of Rel-(3R,4S)-4-((3-chloro-4-fluorophenyl)amino)tetrahydrofuran-3-ol is 2024906-45-2. |
| Q: What is the molecular formula of Rel-(3R,4S)-4-((3-chloro-4-fluorophenyl)amino)tetrahydrofuran-3-ol? |
| A: Molecular formula of Rel-(3R,4S)-4-((3-chloro-4-fluorophenyl)amino)tetrahydrofuran-3-ol is C10H11ClFNO2. |
| Q: What is the Chinese name of 2024906-45-2? |
| A: Chinese name of 2024906-45-2 is 2024906-45-2. |
| Q: What is the InChIKey of Rel-(3R,4S)-4-((3-chloro-4-fluorophenyl)amino)tetrahydrofuran-3-ol? |
| A: InChIKey of Rel-(3R,4S)-4-((3-chloro-4-fluorophenyl)amino)tetrahydrofuran-3-ol is CZEOCSVAJDCVLW-UWVGGRQHSA-N. |
| Q: What is the molecular weight of Rel-(3R,4S)-4-((3-chloro-4-fluorophenyl)amino)tetrahydrofuran-3-ol? |
| A: Molecular weight of Rel-(3R,4S)-4-((3-chloro-4-fluorophenyl)amino)tetrahydrofuran-3-ol is 231.65. |