1-({bicyclo[4.1.0]heptan-3-yl}methyl)-5-bromo-1H-1,2,4-triazol-3-amine
Modify Date: 2026-07-03 19:22:52
![1-({bicyclo[4.1.0]heptan-3-yl}methyl)-5-bromo-1H-1,2,4-triazol-3-amine Structure](https://www.chemsrc.com/extcaspic/340/2024959-54-2.png)
1-({bicyclo[4.1.0]heptan-3-yl}methyl)-5-bromo-1H-1,2,4-triazol-3-amine structure
|
Common Name | 1-({bicyclo[4.1.0]heptan-3-yl}methyl)-5-bromo-1H-1,2,4-triazol-3-amine | ||
|---|---|---|---|---|
| CAS Number | 2024959-54-2 | Molecular Weight | 271.16 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H15BrN4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 1-({bicyclo[4.1.0]heptan-3-yl}methyl)-5-bromo-1H-1,2,4-triazol-3-amine |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C10H15BrN4 |
|---|---|
| Molecular Weight | 271.16 |
| InChIKey | AVACIUZGQWFAIS-UHFFFAOYSA-N |
| SMILES | Nc1nc(Br)n(CC2CCC3CC3C2)n1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the SMILES notation of 1-({bicyclo[4.1.0]heptan-3-yl}methyl)-5-bromo-1H-1,2,4-triazol-3-amine? |
| A: SMILES notation of 1-({bicyclo[4.1.0]heptan-3-yl}methyl)-5-bromo-1H-1,2,4-triazol-3-amine is Nc1nc(Br)n(CC2CCC3CC3C2)n1. |
| Q: What is the English name of 1-({bicyclo[4.1.0]heptan-3-yl}methyl)-5-bromo-1H-1,2,4-triazol-3-amine? |
| A: The English name of 1-({bicyclo[4.1.0]heptan-3-yl}methyl)-5-bromo-1H-1,2,4-triazol-3-amine is 1-({bicyclo[4.1.0]heptan-3-yl}methyl)-5-bromo-1H-1,2,4-triazol-3-amine. |
| Q: What is the CAS number of 1-({bicyclo[4.1.0]heptan-3-yl}methyl)-5-bromo-1H-1,2,4-triazol-3-amine? |
| A: CAS number of 1-({bicyclo[4.1.0]heptan-3-yl}methyl)-5-bromo-1H-1,2,4-triazol-3-amine is 2024959-54-2. |
| Q: What is the molecular formula of 1-({bicyclo[4.1.0]heptan-3-yl}methyl)-5-bromo-1H-1,2,4-triazol-3-amine? |
| A: Molecular formula of 1-({bicyclo[4.1.0]heptan-3-yl}methyl)-5-bromo-1H-1,2,4-triazol-3-amine is C10H15BrN4. |
| Q: What is the Chinese name of 2024959-54-2? |
| A: Chinese name of 2024959-54-2 is 2024959-54-2. |
| Q: What is the InChIKey of 1-({bicyclo[4.1.0]heptan-3-yl}methyl)-5-bromo-1H-1,2,4-triazol-3-amine? |
| A: InChIKey of 1-({bicyclo[4.1.0]heptan-3-yl}methyl)-5-bromo-1H-1,2,4-triazol-3-amine is AVACIUZGQWFAIS-UHFFFAOYSA-N. |
| Q: What is the molecular weight of 1-({bicyclo[4.1.0]heptan-3-yl}methyl)-5-bromo-1H-1,2,4-triazol-3-amine? |
| A: Molecular weight of 1-({bicyclo[4.1.0]heptan-3-yl}methyl)-5-bromo-1H-1,2,4-triazol-3-amine is 271.16. |