Methyl 2-amino-5-{bicyclo[2.2.1]heptan-2-yl}-1,3-thiazole-4-carboxylate
Modify Date: 2026-06-25 19:42:46
![Methyl 2-amino-5-{bicyclo[2.2.1]heptan-2-yl}-1,3-thiazole-4-carboxylate Structure](https://www.chemsrc.com/extcaspic/381/2024965-77-1.png)
Methyl 2-amino-5-{bicyclo[2.2.1]heptan-2-yl}-1,3-thiazole-4-carboxylate structure
|
Common Name | Methyl 2-amino-5-{bicyclo[2.2.1]heptan-2-yl}-1,3-thiazole-4-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 2024965-77-1 | Molecular Weight | 252.33 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H16N2O2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Methyl 2-amino-5-{bicyclo[2.2.1]heptan-2-yl}-1,3-thiazole-4-carboxylate |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C12H16N2O2S |
|---|---|
| Molecular Weight | 252.33 |
| InChIKey | XDYRTJKOOKTZNX-UHFFFAOYSA-N |
| SMILES | COC(=O)c1nc(N)sc1C1CC2CCC1C2 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the CAS number of Methyl 2-amino-5-{bicyclo[2.2.1]heptan-2-yl}-1,3-thiazole-4-carboxylate? |
| A: CAS number of Methyl 2-amino-5-{bicyclo[2.2.1]heptan-2-yl}-1,3-thiazole-4-carboxylate is 2024965-77-1. |
| Q: What is the SMILES notation of Methyl 2-amino-5-{bicyclo[2.2.1]heptan-2-yl}-1,3-thiazole-4-carboxylate? |
| A: SMILES notation of Methyl 2-amino-5-{bicyclo[2.2.1]heptan-2-yl}-1,3-thiazole-4-carboxylate is COC(=O)c1nc(N)sc1C1CC2CCC1C2. |
| Q: What is the molecular formula of Methyl 2-amino-5-{bicyclo[2.2.1]heptan-2-yl}-1,3-thiazole-4-carboxylate? |
| A: Molecular formula of Methyl 2-amino-5-{bicyclo[2.2.1]heptan-2-yl}-1,3-thiazole-4-carboxylate is C12H16N2O2S. |
| Q: What is the molecular weight of Methyl 2-amino-5-{bicyclo[2.2.1]heptan-2-yl}-1,3-thiazole-4-carboxylate? |
| A: Molecular weight of Methyl 2-amino-5-{bicyclo[2.2.1]heptan-2-yl}-1,3-thiazole-4-carboxylate is 252.33. |
| Q: What is the InChIKey of Methyl 2-amino-5-{bicyclo[2.2.1]heptan-2-yl}-1,3-thiazole-4-carboxylate? |
| A: InChIKey of Methyl 2-amino-5-{bicyclo[2.2.1]heptan-2-yl}-1,3-thiazole-4-carboxylate is XDYRTJKOOKTZNX-UHFFFAOYSA-N. |
| Q: What is the English name of Methyl 2-amino-5-{bicyclo[2.2.1]heptan-2-yl}-1,3-thiazole-4-carboxylate? |
| A: The English name of Methyl 2-amino-5-{bicyclo[2.2.1]heptan-2-yl}-1,3-thiazole-4-carboxylate is Methyl 2-amino-5-{bicyclo[2.2.1]heptan-2-yl}-1,3-thiazole-4-carboxylate. |
| Q: What is the Chinese name of 2024965-77-1? |
| A: Chinese name of 2024965-77-1 is 2024965-77-1. |