N-(3-amino-1,1,1-trifluoropropan-2-yl)-2,2-dimethylpropanamide
Modify Date: 2025-10-16 12:02:25
N-(3-amino-1,1,1-trifluoropropan-2-yl)-2,2-dimethylpropanamide structure
|
Common Name | N-(3-amino-1,1,1-trifluoropropan-2-yl)-2,2-dimethylpropanamide | ||
|---|---|---|---|---|
| CAS Number | 2024972-26-5 | Molecular Weight | 212.21 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C8H15F3N2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | N-(3-amino-1,1,1-trifluoropropan-2-yl)-2,2-dimethylpropanamide |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C8H15F3N2O |
|---|---|
| Molecular Weight | 212.21 |
| InChIKey | WTJCQCNBEAMARV-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C(=O)NC(CN)C(F)(F)F |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the CAS number of N-(3-amino-1,1,1-trifluoropropan-2-yl)-2,2-dimethylpropanamide? |
| A: CAS number of N-(3-amino-1,1,1-trifluoropropan-2-yl)-2,2-dimethylpropanamide is 2024972-26-5. |
| Q: What is the molecular weight of N-(3-amino-1,1,1-trifluoropropan-2-yl)-2,2-dimethylpropanamide? |
| A: Molecular weight of N-(3-amino-1,1,1-trifluoropropan-2-yl)-2,2-dimethylpropanamide is 212.21. |
| Q: What is the Chinese name of 2024972-26-5? |
| A: Chinese name of 2024972-26-5 is 2024972-26-5. |
| Q: What is the English name of N-(3-amino-1,1,1-trifluoropropan-2-yl)-2,2-dimethylpropanamide? |
| A: The English name of N-(3-amino-1,1,1-trifluoropropan-2-yl)-2,2-dimethylpropanamide is N-(3-amino-1,1,1-trifluoropropan-2-yl)-2,2-dimethylpropanamide. |
| Q: What is the InChIKey of N-(3-amino-1,1,1-trifluoropropan-2-yl)-2,2-dimethylpropanamide? |
| A: InChIKey of N-(3-amino-1,1,1-trifluoropropan-2-yl)-2,2-dimethylpropanamide is WTJCQCNBEAMARV-UHFFFAOYSA-N. |
| Q: What is the molecular formula of N-(3-amino-1,1,1-trifluoropropan-2-yl)-2,2-dimethylpropanamide? |
| A: Molecular formula of N-(3-amino-1,1,1-trifluoropropan-2-yl)-2,2-dimethylpropanamide is C8H15F3N2O. |
| Q: What is the SMILES notation of N-(3-amino-1,1,1-trifluoropropan-2-yl)-2,2-dimethylpropanamide? |
| A: SMILES notation of N-(3-amino-1,1,1-trifluoropropan-2-yl)-2,2-dimethylpropanamide is CC(C)(C)C(=O)NC(CN)C(F)(F)F. |