1,4-dihydroxy-2-(2-hydroxyethylamino)anthracene-9,10-dione structure
|
Common Name | 1,4-dihydroxy-2-(2-hydroxyethylamino)anthracene-9,10-dione | ||
|---|---|---|---|---|
| CAS Number | 20253-58-1 | Molecular Weight | 299.27800 | |
| Density | 1.58g/cm3 | Boiling Point | 606.9ºC at 760 mmHg | |
| Molecular Formula | C16H13NO5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 320.8ºC | |
| Name | 1,4-dihydroxy-2-(2-hydroxyethylamino)anthracene-9,10-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.58g/cm3 |
|---|---|
| Boiling Point | 606.9ºC at 760 mmHg |
| Molecular Formula | C16H13NO5 |
| Molecular Weight | 299.27800 |
| Flash Point | 320.8ºC |
| Exact Mass | 299.07900 |
| PSA | 106.86000 |
| LogP | 1.35040 |
| Vapour Pressure | 1.4E-15mmHg at 25°C |
| Index of Refraction | 1.763 |
| InChIKey | ALSXGHCUQWPHGN-UHFFFAOYSA-N |
| SMILES | O=C1c2ccccc2C(=O)c2c(O)c(NCCO)cc(O)c21 |
|
~91%
1,4-dihydroxy-2... CAS#:20253-58-1 |
| Literature: Stefanska; Dzieduszycka; Martelli; Antonini; Borowski Journal of Organic Chemistry, 1993 , vol. 58, # 6 p. 1568 - 1569 |
|
~%
1,4-dihydroxy-2... CAS#:20253-58-1 |
| Literature: Takei, Toshio; Matsuoka, Masaru; Kitao, Teijiro Bulletin of the Chemical Society of Japan, 1981 , vol. 54, # 9 p. 2735 - 2738 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| 1,4-Dihydroxy-2-<(2-hydroxyethyl)amino>-9,10-anthracenedione |