5-amino-1-benzyl-triazole-4-carbothioamide structure
|
Common Name | 5-amino-1-benzyl-triazole-4-carbothioamide | ||
|---|---|---|---|---|
| CAS Number | 20271-34-5 | Molecular Weight | 233.29300 | |
| Density | 1.46g/cm3 | Boiling Point | 503.3ºC at 760 mmHg | |
| Molecular Formula | C10H11N5S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 258.2ºC | |
| Name | 5-amino-1-benzyltriazole-4-carbothioamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.46g/cm3 |
|---|---|
| Boiling Point | 503.3ºC at 760 mmHg |
| Molecular Formula | C10H11N5S |
| Molecular Weight | 233.29300 |
| Flash Point | 258.2ºC |
| Exact Mass | 233.07400 |
| PSA | 114.84000 |
| LogP | 1.82430 |
| Vapour Pressure | 2.95E-10mmHg at 25°C |
| Index of Refraction | 1.749 |
| InChIKey | XQTIYEPLNKHOQF-UHFFFAOYSA-N |
| SMILES | NC(=S)c1nnn(Cc2ccccc2)c1N |
|
~%
5-amino-1-benzy... CAS#:20271-34-5 |
| Literature: Hoover; Day Journal of the American Chemical Society, 1956 , vol. 78, p. 5832,5835 |
|
~%
5-amino-1-benzy... CAS#:20271-34-5 |
| Literature: Hoover; Day Journal of the American Chemical Society, 1956 , vol. 78, p. 5832,5835 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 4-Amino-3-benzyl-1,2,3-triazol-5-thiocarboxamid |