5-Amino-1-phenyl-triazole-4-carbohydrazide structure
|
Common Name | 5-Amino-1-phenyl-triazole-4-carbohydrazide | ||
|---|---|---|---|---|
| CAS Number | 20271-38-9 | Molecular Weight | 218.21500 | |
| Density | 1.6g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C9H10N6O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 5-amino-1-phenyltriazole-4-carbohydrazide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.6g/cm3 |
|---|---|
| Molecular Formula | C9H10N6O |
| Molecular Weight | 218.21500 |
| Exact Mass | 218.09200 |
| PSA | 111.85000 |
| LogP | 1.12540 |
| Index of Refraction | 1.771 |
| InChIKey | HTDFXYPRHOAYRG-UHFFFAOYSA-N |
| SMILES | NNC(=O)c1nnn(-c2ccccc2)c1N |
|
~0%
5-Amino-1-pheny... CAS#:20271-38-9 |
| Literature: Cao, Zi-Ping; Quan, Bin; Dong, Heng-Shan Journal of the Chinese Chemical Society, 2008 , vol. 55, # 4 p. 761 - 767 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| 5-amino-1-phenyl-4-triazolecarbohydrazide |
| 5-amino-1-phenyl-1h-1,2,3-triazole-4-carbohydrazide |