[2-(3-Fluorophenyl)-4-methyl-1,3-oxazol-5-yl]methanol structure
|
Common Name | [2-(3-Fluorophenyl)-4-methyl-1,3-oxazol-5-yl]methanol | ||
|---|---|---|---|---|
| CAS Number | 2029900-18-1 | Molecular Weight | 207.20 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H10FNO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | [2-(3-Fluorophenyl)-4-methyl-1,3-oxazol-5-yl]methanol |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C11H10FNO2 |
|---|---|
| Molecular Weight | 207.20 |
| InChIKey | VTEKVNCQVOBFKS-UHFFFAOYSA-N |
| SMILES | Cc1nc(-c2cccc(F)c2)oc1CO |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the Chinese name of 2029900-18-1? |
| A: Chinese name of 2029900-18-1 is 2029900-18-1. |
| Q: What is the InChIKey of [2-(3-Fluorophenyl)-4-methyl-1,3-oxazol-5-yl]methanol? |
| A: InChIKey of [2-(3-Fluorophenyl)-4-methyl-1,3-oxazol-5-yl]methanol is VTEKVNCQVOBFKS-UHFFFAOYSA-N. |
| Q: What is the SMILES notation of [2-(3-Fluorophenyl)-4-methyl-1,3-oxazol-5-yl]methanol? |
| A: SMILES notation of [2-(3-Fluorophenyl)-4-methyl-1,3-oxazol-5-yl]methanol is Cc1nc(-c2cccc(F)c2)oc1CO. |
| Q: What is the molecular weight of [2-(3-Fluorophenyl)-4-methyl-1,3-oxazol-5-yl]methanol? |
| A: Molecular weight of [2-(3-Fluorophenyl)-4-methyl-1,3-oxazol-5-yl]methanol is 207.20. |
| Q: What is the English name of [2-(3-Fluorophenyl)-4-methyl-1,3-oxazol-5-yl]methanol? |
| A: The English name of [2-(3-Fluorophenyl)-4-methyl-1,3-oxazol-5-yl]methanol is [2-(3-Fluorophenyl)-4-methyl-1,3-oxazol-5-yl]methanol. |
| Q: What is the CAS number of [2-(3-Fluorophenyl)-4-methyl-1,3-oxazol-5-yl]methanol? |
| A: CAS number of [2-(3-Fluorophenyl)-4-methyl-1,3-oxazol-5-yl]methanol is 2029900-18-1. |
| Q: What is the molecular formula of [2-(3-Fluorophenyl)-4-methyl-1,3-oxazol-5-yl]methanol? |
| A: Molecular formula of [2-(3-Fluorophenyl)-4-methyl-1,3-oxazol-5-yl]methanol is C11H10FNO2. |