1-(2-methylbenzoyl)piperidin-4-one structure
|
Common Name | 1-(2-methylbenzoyl)piperidin-4-one | ||
|---|---|---|---|---|
| CAS Number | 203186-44-1 | Molecular Weight | 217.26400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H15NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-(2-Methylbenzoyl)-4-piperidinone |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C13H15NO2 |
|---|---|
| Molecular Weight | 217.26400 |
| Exact Mass | 217.11000 |
| PSA | 37.38000 |
| LogP | 1.73800 |
| InChIKey | OXHVRXMYJFCTGL-UHFFFAOYSA-N |
| SMILES | Cc1ccccc1C(=O)N1CCC(=O)CC1 |
| HS Code | 2933399090 |
|---|
|
~%
1-(2-methylbenz... CAS#:203186-44-1 |
| Literature: ASTRAZENECA AB Patent: US2007/287695 A1, 2007 ; Location in patent: Page/Page column 76 ; US 20070287695 A1 |
|
~%
1-(2-methylbenz... CAS#:203186-44-1 |
| Literature: Miller, Nicole R.; Daniels, R. Nathan; Bridges, Thomas M.; Brady, Ashley E.; Conn, P. Jeffrey; Lindsley, Craig W. Bioorganic and Medicinal Chemistry Letters, 2008 , vol. 18, # 20 p. 5443 - 5447 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 1-(2-methylbenzoyl)piperidin-4-one |
| Methanone,1H-inden-3-yl(2-methylphenyl) |
| 1-(2-methylbenzoyl)-3H-indene |