1,1-DIBROMO-3,3,4,4,4-PENTAFLUORO-2-BUTANONE structure
|
Common Name | 1,1-DIBROMO-3,3,4,4,4-PENTAFLUORO-2-BUTANONE | ||
|---|---|---|---|---|
| CAS Number | 203302-96-9 | Molecular Weight | 319.85000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C4HBr2F5O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1,1-dibromo-3,3,4,4,4-pentafluorobutan-2-one |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C4HBr2F5O |
|---|---|
| Molecular Weight | 319.85000 |
| Exact Mass | 317.83100 |
| PSA | 17.07000 |
| LogP | 2.86900 |
| InChIKey | OJSMVZNNJAOBLZ-UHFFFAOYSA-N |
| SMILES | O=C(C(Br)Br)C(F)(F)C(F)(F)F |
| HS Code | 2914700090 |
|---|
| HS Code | 2914700090 |
|---|---|
| Summary | HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |
| pc2280 |