4-Bromo-2-methyl-7-nitro-2,3-dihydrobenzofuran
Modify Date: 2026-07-16 00:04:14
4-Bromo-2-methyl-7-nitro-2,3-dihydrobenzofuran structure
|
Common Name | 4-Bromo-2-methyl-7-nitro-2,3-dihydrobenzofuran | ||
|---|---|---|---|---|
| CAS Number | 2033056-89-0 | Molecular Weight | 258.07 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C9H8BrNO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 4-Bromo-2-methyl-7-nitro-2,3-dihydrobenzofuran |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C9H8BrNO3 |
|---|---|
| Molecular Weight | 258.07 |
| InChIKey | VCSOQJCQQYZMRA-UHFFFAOYSA-N |
| SMILES | CC1Cc2c(Br)ccc([N+](=O)[O-])c2O1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the English name of 4-Bromo-2-methyl-7-nitro-2,3-dihydrobenzofuran? |
| A: The English name of 4-Bromo-2-methyl-7-nitro-2,3-dihydrobenzofuran is 4-Bromo-2-methyl-7-nitro-2,3-dihydrobenzofuran. |
| Q: What is the Chinese name of 2033056-89-0? |
| A: Chinese name of 2033056-89-0 is 2033056-89-0. |
| Q: What is the CAS number of 4-Bromo-2-methyl-7-nitro-2,3-dihydrobenzofuran? |
| A: CAS number of 4-Bromo-2-methyl-7-nitro-2,3-dihydrobenzofuran is 2033056-89-0. |
| Q: What is the InChIKey of 4-Bromo-2-methyl-7-nitro-2,3-dihydrobenzofuran? |
| A: InChIKey of 4-Bromo-2-methyl-7-nitro-2,3-dihydrobenzofuran is VCSOQJCQQYZMRA-UHFFFAOYSA-N. |
| Q: What is the molecular formula of 4-Bromo-2-methyl-7-nitro-2,3-dihydrobenzofuran? |
| A: Molecular formula of 4-Bromo-2-methyl-7-nitro-2,3-dihydrobenzofuran is C9H8BrNO3. |
| Q: What is the SMILES notation of 4-Bromo-2-methyl-7-nitro-2,3-dihydrobenzofuran? |
| A: SMILES notation of 4-Bromo-2-methyl-7-nitro-2,3-dihydrobenzofuran is CC1Cc2c(Br)ccc([N+](=O)[O-])c2O1. |
| Q: What is the molecular weight of 4-Bromo-2-methyl-7-nitro-2,3-dihydrobenzofuran? |
| A: Molecular weight of 4-Bromo-2-methyl-7-nitro-2,3-dihydrobenzofuran is 258.07. |