N-(4-sec-Butyl-phenyl)-2-chloro-acetamide structure
|
Common Name | N-(4-sec-Butyl-phenyl)-2-chloro-acetamide | ||
|---|---|---|---|---|
| CAS Number | 20331-26-4 | Molecular Weight | 225.71500 | |
| Density | 1.125g/cm3 | Boiling Point | 368.7ºC at 760 mmHg | |
| Molecular Formula | C12H16ClNO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 176.8ºC | |
| Name | N-(4-butan-2-ylphenyl)-2-chloroacetamide |
|---|
| Density | 1.125g/cm3 |
|---|---|
| Boiling Point | 368.7ºC at 760 mmHg |
| Molecular Formula | C12H16ClNO |
| Molecular Weight | 225.71500 |
| Flash Point | 176.8ºC |
| Exact Mass | 225.09200 |
| PSA | 29.10000 |
| LogP | 3.45040 |
| Vapour Pressure | 1.25E-05mmHg at 25°C |
| Index of Refraction | 1.553 |
| InChIKey | VHCITOVVEMWCKN-UHFFFAOYSA-N |
| SMILES | CCC(C)c1ccc(NC(=O)CCl)cc1 |
| HS Code | 2924299090 |
|---|
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |