2-Bromo-6-fluoro-alpha-(1-Boc-4-piperidyl)benzyl Alcohol
Modify Date: 2026-07-19 10:45:39
2-Bromo-6-fluoro-alpha-(1-Boc-4-piperidyl)benzyl Alcohol structure
|
Common Name | 2-Bromo-6-fluoro-alpha-(1-Boc-4-piperidyl)benzyl Alcohol | ||
|---|---|---|---|---|
| CAS Number | 2033173-28-1 | Molecular Weight | 388.3 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C17H23BrFNO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2-Bromo-6-fluoro-alpha-(1-Boc-4-piperidyl)benzyl Alcohol |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C17H23BrFNO3 |
|---|---|
| Molecular Weight | 388.3 |
| InChIKey | GMZVBOYMLPLEJD-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC(C(O)c2c(F)cccc2Br)CC1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular formula of 2-Bromo-6-fluoro-alpha-(1-Boc-4-piperidyl)benzyl Alcohol? |
| A: Molecular formula of 2-Bromo-6-fluoro-alpha-(1-Boc-4-piperidyl)benzyl Alcohol is C17H23BrFNO3. |
| Q: What is the Chinese name of 2033173-28-1? |
| A: Chinese name of 2033173-28-1 is 2033173-28-1. |
| Q: What is the CAS number of 2-Bromo-6-fluoro-alpha-(1-Boc-4-piperidyl)benzyl Alcohol? |
| A: CAS number of 2-Bromo-6-fluoro-alpha-(1-Boc-4-piperidyl)benzyl Alcohol is 2033173-28-1. |
| Q: What is the SMILES notation of 2-Bromo-6-fluoro-alpha-(1-Boc-4-piperidyl)benzyl Alcohol? |
| A: SMILES notation of 2-Bromo-6-fluoro-alpha-(1-Boc-4-piperidyl)benzyl Alcohol is CC(C)(C)OC(=O)N1CCC(C(O)c2c(F)cccc2Br)CC1. |
| Q: What is the InChIKey of 2-Bromo-6-fluoro-alpha-(1-Boc-4-piperidyl)benzyl Alcohol? |
| A: InChIKey of 2-Bromo-6-fluoro-alpha-(1-Boc-4-piperidyl)benzyl Alcohol is GMZVBOYMLPLEJD-UHFFFAOYSA-N. |
| Q: What is the molecular weight of 2-Bromo-6-fluoro-alpha-(1-Boc-4-piperidyl)benzyl Alcohol? |
| A: Molecular weight of 2-Bromo-6-fluoro-alpha-(1-Boc-4-piperidyl)benzyl Alcohol is 388.3. |
| Q: What is the English name of 2-Bromo-6-fluoro-alpha-(1-Boc-4-piperidyl)benzyl Alcohol? |
| A: The English name of 2-Bromo-6-fluoro-alpha-(1-Boc-4-piperidyl)benzyl Alcohol is 2-Bromo-6-fluoro-alpha-(1-Boc-4-piperidyl)benzyl Alcohol. |